1998-03-16 10:05:41 +00:00
|
|
|
/* GIF loading and saving file filter for The GIMP version 1.0
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
1998-03-16 10:05:41 +00:00
|
|
|
* - Adam D. Moss
|
|
|
|
* - Peter Mattis
|
|
|
|
* - Spencer Kimball
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
1998-03-16 10:05:41 +00:00
|
|
|
* Based around original GIF code by David Koblas.
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
|
|
|
*
|
1998-10-09 18:01:35 +00:00
|
|
|
* Version 2.1.0 - 98/10/09
|
1998-03-16 10:05:41 +00:00
|
|
|
* Adam D. Moss - <adam@gimp.org> <adam@foxbox.org>
|
1997-11-24 22:05:25 +00:00
|
|
|
*/
|
|
|
|
/*
|
|
|
|
* This filter uses code taken from the "giftopnm" and "ppmtogif" programs
|
|
|
|
* which are part of the "netpbm" package.
|
|
|
|
*/
|
|
|
|
/*
|
|
|
|
* "The Graphics Interchange Format(c) is the Copyright property of
|
|
|
|
* CompuServe Incorporated. GIF(sm) is a Service Mark property of
|
|
|
|
* CompuServe Incorporated."
|
|
|
|
*/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* REVISION HISTORY
|
|
|
|
*
|
1998-10-09 18:01:35 +00:00
|
|
|
* 98/10/09
|
|
|
|
* 2.01.00 - Added support for persistant GIF Comments through
|
|
|
|
* the GIMP 1.1 Parasite mechanism where available.
|
|
|
|
* Did some user-interface tweaks.
|
|
|
|
* Fixed a bug when trying to save a GIF smaller
|
|
|
|
* than five pixels high as interlaced.
|
1998-04-29 10:48:02 +00:00
|
|
|
*
|
1998-09-28 17:14:29 +00:00
|
|
|
* 98/09/28
|
|
|
|
* 2.00.05 - Fixed TigerT's Infinite GIF Bug. Icky one.
|
|
|
|
*
|
1998-09-15 20:34:30 +00:00
|
|
|
* 98/09/15
|
|
|
|
* 2.00.04 - The facility to specify the background colour of
|
|
|
|
* a transparent/animated GIF for non-transparent
|
|
|
|
* viewers now works very much more consistantly.
|
|
|
|
*
|
|
|
|
* The only situations in which it will fail to work
|
|
|
|
* as expected now are those where file size can be reduced
|
|
|
|
* (abeit not by much, as the plugin is sometimes more pessimistic
|
|
|
|
* than it need be) by re-using an existing unused colour
|
|
|
|
* index rather than using another bit per pixel in the
|
|
|
|
* encoded file. That will never be an issue with an image
|
|
|
|
* which was freshly converted from RGB to INDEXED with the
|
|
|
|
* Quantize option, as that option removes any unused colours
|
|
|
|
* from the image.
|
|
|
|
*
|
|
|
|
* Let me know if you find the consistancy/size tradeoff more
|
|
|
|
* annoying than helpful and I can adjust it. IMHO it is too
|
|
|
|
* arcane a feature to present to any user as a runtime option.
|
|
|
|
*
|
1998-05-21 20:26:06 +00:00
|
|
|
* 98/05/18
|
|
|
|
* 2.00.03 - If we did manage to decode at least one frame of a
|
|
|
|
* gif, be sure to display the resulting image even if
|
|
|
|
* it terminated abruptly.
|
|
|
|
*
|
1998-04-29 10:48:02 +00:00
|
|
|
* 98/04/28
|
|
|
|
* 2.00.02 - Fixed a bug with (ms) tag parsing.
|
|
|
|
*
|
1998-03-17 09:39:40 +00:00
|
|
|
* 98/03/16
|
|
|
|
* 2.00.01 - Fixed a long-standing bug when loading GIFs which layer
|
|
|
|
* opaque frames onto transparent ones.
|
|
|
|
*
|
1998-03-16 10:05:41 +00:00
|
|
|
* 98/03/15
|
|
|
|
* 2.00.00 - No longer beta. Uses the current GIMP brush background
|
|
|
|
* colour as the transparent-index colour for viewers that
|
|
|
|
* don't know about transparency, instead of magenta. Note
|
|
|
|
* that this is by no means likely to actually work, but
|
|
|
|
* is more likely to do so if your image has been freshly
|
|
|
|
* to-index'd before saving.
|
|
|
|
*
|
|
|
|
* Also added some analysis to gif-reading to prevent the
|
|
|
|
* number of encoded bits being pumped up inadvertantly for
|
|
|
|
* successive load/saves of the same image. [Adam]
|
|
|
|
*
|
1997-12-12 10:01:21 +00:00
|
|
|
* 97/12/11
|
|
|
|
* 1.99.18 - Bleh. Disposals should specify how the next frame will
|
|
|
|
* be composed with this frame, NOT how this frame will
|
|
|
|
* be composed with the previous frame. Fixed. [Adam]
|
|
|
|
*
|
1997-12-08 00:22:45 +00:00
|
|
|
* 97/11/30
|
|
|
|
* 1.99.17 - No more bogus transparency indices in animated GIFs,
|
|
|
|
* hopefully. Saved files are better-behaved, sometimes
|
|
|
|
* smaller. [Adam]
|
|
|
|
*
|
1997-11-24 22:05:25 +00:00
|
|
|
* 97/09/29
|
|
|
|
* 1.99.16 - Added a dialog for the user to choose what to do if
|
|
|
|
* one of the layers of the image extends beyond the image
|
|
|
|
* borders - crop or cancel. Added code behind it.
|
|
|
|
*
|
|
|
|
* Corrected the number of bits for the base image to be
|
|
|
|
* on the generous side. Hopefully we can no longer generate
|
|
|
|
* GIFs which make XV barf.
|
|
|
|
*
|
|
|
|
* Now a lot more careful about whether we choose to encode
|
|
|
|
* as a GIF87a or a GIF89a. Hopefully does everything by the
|
|
|
|
* book. It should now be nigh-on impossible to torture the
|
|
|
|
* plugin into generating a GIF which isn't extremely well
|
|
|
|
* behaved with respect to the GIF89a specification.
|
|
|
|
*
|
|
|
|
* Fixed(?) a lot of dialog callback details, should now be
|
|
|
|
* happy with window deletion (GTK+970925). Fixed the
|
|
|
|
* cancellation of a save. [Adam]
|
|
|
|
*
|
|
|
|
* 97/09/16
|
|
|
|
* 1.99.15 - Hey! We can now cope with loading images which change
|
|
|
|
* colourmap between frames. This plugin will never save
|
|
|
|
* such abominations of nature while I still live, though.
|
|
|
|
* There should be no noncorrupt GIF in the universe which
|
|
|
|
* GIMP can't load and play now. [Adam]
|
|
|
|
*
|
|
|
|
* 97/09/14
|
|
|
|
* 1.99.14 - Added a check for layers whose extents don't lay
|
|
|
|
* within the image boundaries, which would make it a
|
|
|
|
* lot harder to generate badly-behaved GIFs. Doesn't
|
|
|
|
* do anything about it yet, but it should crop all layers
|
|
|
|
* to the image boundaries. Also, there's now a (separate)
|
|
|
|
* animation-preview plugin! [Adam]
|
|
|
|
*
|
|
|
|
* 97/08/29
|
|
|
|
* 1.99.13 - Basic ability to embed GIF comments within saved images.
|
|
|
|
* Fixed a bug with encoding the number of loops in a GIF file -
|
|
|
|
* would have been important, but we're not using that feature
|
|
|
|
* yet anyway. ;)
|
|
|
|
* Subtly improved dialog layout a little. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/25
|
|
|
|
* 1.99.12 - Fixed attempts to load GIFs which don't exist. Made a
|
|
|
|
* related cosmetic adjustment. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/10
|
|
|
|
* 1.99.11 - Fixed a bug with loading and saving GIFs where the bottom
|
|
|
|
* layer wasn't the same size as the image. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/06
|
|
|
|
* 1.99.10 - New 'save' dialog, now most of the default behaviour of
|
|
|
|
* animated GIF saving is user-settable (looping, default
|
|
|
|
* time between frames, etc.)
|
|
|
|
* PDB entry for saving is no longer compatible. Fortunately
|
|
|
|
* I don't think that anyone is using file_gif_save in
|
|
|
|
* scripts. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/05
|
|
|
|
* 1.99.9 - More animated GIF work: now loads and saves frame disposal
|
|
|
|
* information. This is neat and will also allow some delta
|
|
|
|
* stuff in the future.
|
|
|
|
* The disposal-method is kept in the layer name, like the timing
|
|
|
|
* info.
|
|
|
|
* (replace) - this frame replaces whatever else has been shown
|
|
|
|
* so far.
|
|
|
|
* (combine) - this frame builds apon the previous frame.
|
|
|
|
* If a disposal method is not specified, it is assumed to mean
|
|
|
|
* "don't care." [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/04
|
|
|
|
* 1.99.8 - Can save per-frame timing information too, now. The time
|
|
|
|
* for which a frame is visible is specified within the layer name
|
|
|
|
* as i,e. (250ms). If a frame doesn't have this timing value
|
|
|
|
* it defaults to lasting 100ms. [Adam]
|
|
|
|
*
|
|
|
|
* 97/07/02
|
|
|
|
* 1.99.7 - For animated GIFs, fixed the saving of timing information for
|
|
|
|
* frames which couldn't be made transparent.
|
|
|
|
* Added the loading of timing information into the layer
|
|
|
|
* names. Adjusted GIMP's GIF magic number very slightly. [Adam]
|
|
|
|
*
|
|
|
|
* 97/06/30
|
|
|
|
* 1.99.6 - Now saves GRAY and GRAYA images, albeit not always
|
|
|
|
* optimally (yet). [Adam]
|
|
|
|
*
|
|
|
|
* 97/06/25
|
|
|
|
* 1.99.5 - Good, the transparancy-on-big-architectures bug is
|
|
|
|
* fixed. Cleaned up some stuff.
|
|
|
|
* (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/06/23
|
|
|
|
* 1.99.4 - Trying to fix some endianness/word-size problems with
|
|
|
|
* transparent gif-saving on some architectures... does
|
|
|
|
* this help? (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/18
|
|
|
|
* 1.99.3 - Fixed the problem with GIFs getting loop extensions even
|
|
|
|
* if they only had one frame (thanks to Zach for noticing -
|
|
|
|
* git! :) ) (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/17
|
|
|
|
* 1.99.2 - Can now save animated GIFs. Correctly handles saving of
|
|
|
|
* image offsets. Uses N*tscape extentions to loop infinitely.
|
|
|
|
* Some notable shortcomings - see TODO list below.
|
|
|
|
* (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/16
|
|
|
|
* 1.99.1 - Implemented image offsets in animated GIF loading. Requires
|
|
|
|
* a fix to gimp_layer_translate in libgimp/gimplayer.c if used
|
|
|
|
* with GIMP versions <= 0.99.10. Started work on saving animated
|
|
|
|
* GIFs. Started TODO list. (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* 97/05/15
|
|
|
|
* 1.99.0 - Started revision log. GIF plugin now loads/saves INDEXED
|
|
|
|
* and INDEXEDA images with correct transparency where possible.
|
|
|
|
* Loads multi-image (animated) GIFs as a framestack implemented
|
|
|
|
* in GIMP layers. Some bug fixes to original code, some new bugs
|
|
|
|
* cheerfully added. (Adam D. Moss, adam@foxbox.org)
|
|
|
|
*
|
|
|
|
* Previous versions - load/save INDEXED images.
|
|
|
|
* (Peter Mattis & Spencer Kimball, gimp@scam.xcf.berkeley.edu)
|
|
|
|
*/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* TODO (more *'s means more important!)
|
|
|
|
*
|
|
|
|
* - Show GIF comments in a popup window?
|
|
|
|
*
|
|
|
|
* - PDB stuff for comments
|
|
|
|
*
|
|
|
|
* - 'requantize' option for INDEXEDA images which really have 256 colours
|
|
|
|
* in them
|
|
|
|
*
|
|
|
|
* - Be a bit smarter about finding unused/superfluous colour indices for
|
|
|
|
* lossless colour crunching of INDEXEDA images. (Specifically, look
|
|
|
|
* for multiple indices which correspond to the same physical colour.)
|
|
|
|
*
|
|
|
|
* - Tidy up parameters for the GIFEncode routines
|
|
|
|
*
|
|
|
|
* - Remove unused colourmap entries for GRAYSCALE images.
|
|
|
|
*
|
1998-09-15 20:34:30 +00:00
|
|
|
* - Button to activate the animation preview plugin from the GIF-save
|
|
|
|
* dialog.
|
1997-11-24 22:05:25 +00:00
|
|
|
*
|
|
|
|
*/
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* Copyright notice for code which this plugin was long ago derived from */
|
1997-11-24 22:05:25 +00:00
|
|
|
/* +-------------------------------------------------------------------+ */
|
|
|
|
/* | Copyright 1990, 1991, 1993, David Koblas. (koblas@netcom.com) | */
|
|
|
|
/* | Permission to use, copy, modify, and distribute this software | */
|
|
|
|
/* | and its documentation for any purpose and without fee is hereby | */
|
|
|
|
/* | granted, provided that the above copyright notice appear in all | */
|
|
|
|
/* | copies and that both that copyright notice and this permission | */
|
|
|
|
/* | notice appear in supporting documentation. This software is | */
|
|
|
|
/* | provided "as is" without express or implied warranty. | */
|
|
|
|
/* +-------------------------------------------------------------------+ */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
#include <stdio.h>
|
|
|
|
#include <stdlib.h>
|
|
|
|
#include <string.h>
|
|
|
|
#include <ctype.h>
|
|
|
|
#include "gtk/gtk.h"
|
|
|
|
#include "libgimp/gimp.h"
|
|
|
|
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* uncomment the line below for a little debugging info */
|
|
|
|
/* #define GIFDEBUG yesplease */
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
/* Wear your GIMP with pride! */
|
|
|
|
#define DEFAULT_COMMENT "Made with GIMP"
|
|
|
|
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* Does the version of GIMP we're compiling for support
|
|
|
|
data attachments to images? ('Parasites') */
|
|
|
|
#ifdef _GIMPPARASITE_H_
|
|
|
|
#define FACEHUGGERS aieee
|
|
|
|
#endif
|
|
|
|
/* PS: I know that technically facehuggers aren't parasites,
|
|
|
|
the pupal-forms are. But facehuggers are cute. */
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
typedef struct
|
|
|
|
{
|
|
|
|
int interlace;
|
|
|
|
int loop;
|
|
|
|
int default_delay;
|
|
|
|
int default_dispose;
|
|
|
|
} GIFSaveVals;
|
|
|
|
|
|
|
|
typedef struct
|
|
|
|
{
|
|
|
|
gint run;
|
|
|
|
} GIFSaveInterface;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* Declare some local functions.
|
|
|
|
*/
|
|
|
|
static void query (void);
|
|
|
|
static void run (char *name,
|
|
|
|
int nparams,
|
|
|
|
GParam *param,
|
|
|
|
int *nreturn_vals,
|
|
|
|
GParam **return_vals);
|
|
|
|
static gint32 load_image (char *filename);
|
|
|
|
static gint save_image (char *filename,
|
|
|
|
gint32 image_ID,
|
|
|
|
gint32 drawable_ID);
|
|
|
|
|
|
|
|
static gboolean
|
|
|
|
boundscheck (gint32 image_ID);
|
|
|
|
static gboolean
|
|
|
|
badbounds_dialog ( void );
|
|
|
|
|
|
|
|
static void
|
|
|
|
cropok_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void
|
|
|
|
cropclose_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void
|
|
|
|
cropcancel_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
|
|
|
|
static gint save_dialog ( gint32 image_ID );
|
|
|
|
|
|
|
|
static void save_close_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void save_ok_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void save_cancel_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void save_windelete_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
1998-10-09 18:01:35 +00:00
|
|
|
static void disposal_select_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
1997-11-24 22:05:25 +00:00
|
|
|
static void save_toggle_update (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void save_entry_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
static void comment_entry_callback (GtkWidget *widget,
|
|
|
|
gpointer data);
|
|
|
|
|
|
|
|
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
static gint radio_pressed[3];
|
|
|
|
|
|
|
|
static guchar used_cmap[3][256];
|
1997-11-24 22:05:25 +00:00
|
|
|
static gboolean can_crop;
|
1998-03-16 10:05:41 +00:00
|
|
|
static guchar highest_used_index;
|
1998-10-09 18:01:35 +00:00
|
|
|
static gboolean promote_to_rgb = FALSE;
|
1998-03-16 10:05:41 +00:00
|
|
|
static guchar gimp_cmap[768];
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
GParasite* comment_parasite = NULL;
|
|
|
|
#endif
|
1998-03-16 10:05:41 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
/* For compression code */
|
|
|
|
static int Interlace;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
GPlugInInfo PLUG_IN_INFO =
|
|
|
|
{
|
|
|
|
NULL, /* init_proc */
|
|
|
|
NULL, /* quit_proc */
|
|
|
|
query, /* query_proc */
|
|
|
|
run, /* run_proc */
|
|
|
|
};
|
|
|
|
|
|
|
|
static GIFSaveVals gsvals =
|
|
|
|
{
|
|
|
|
FALSE, /* interlace */
|
|
|
|
TRUE, /* loop infinitely */
|
|
|
|
100, /* default_delay between frames (100ms) */
|
|
|
|
0 /* default_dispose = "don't care" */
|
|
|
|
};
|
|
|
|
|
|
|
|
static GIFSaveInterface gsint =
|
|
|
|
{
|
|
|
|
FALSE /* run */
|
|
|
|
};
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
MAIN ()
|
|
|
|
|
|
|
|
static void
|
|
|
|
query ()
|
|
|
|
{
|
|
|
|
static GParamDef load_args[] =
|
|
|
|
{
|
|
|
|
{ PARAM_INT32, "run_mode", "Interactive, non-interactive" },
|
|
|
|
{ PARAM_STRING, "filename", "The name of the file to load" },
|
|
|
|
{ PARAM_STRING, "raw_filename", "The name entered" },
|
|
|
|
};
|
|
|
|
static GParamDef load_return_vals[] =
|
|
|
|
{
|
|
|
|
{ PARAM_IMAGE, "image", "Output image" },
|
|
|
|
};
|
|
|
|
static int nload_args = sizeof (load_args) / sizeof (load_args[0]);
|
|
|
|
static int nload_return_vals = sizeof (load_return_vals) / sizeof (load_return_vals[0]);
|
|
|
|
|
|
|
|
static GParamDef save_args[] =
|
|
|
|
{
|
|
|
|
{ PARAM_INT32, "run_mode", "Interactive, non-interactive" },
|
|
|
|
{ PARAM_IMAGE, "image", "Image to save" },
|
|
|
|
{ PARAM_DRAWABLE, "drawable", "Drawable to save" },
|
|
|
|
{ PARAM_STRING, "filename", "The name of the file to save the image in" },
|
|
|
|
{ PARAM_STRING, "raw_filename", "The name entered" },
|
1998-10-09 18:01:35 +00:00
|
|
|
{ PARAM_INT32, "interlace", "Try to save as interlaced" },
|
1997-11-24 22:05:25 +00:00
|
|
|
{ PARAM_INT32, "loop", "(animated gif) loop infinitely" },
|
|
|
|
{ PARAM_INT32, "default_delay", "(animated gif) Default delay between framese in milliseconds" },
|
|
|
|
{ PARAM_INT32, "default_dispose", "(animated gif) Default disposal type (0=`don't care`, 1=combine, 2=replace)" }
|
|
|
|
};
|
|
|
|
static int nsave_args = sizeof (save_args) / sizeof (save_args[0]);
|
|
|
|
|
|
|
|
gimp_install_procedure ("file_gif_load",
|
|
|
|
"loads files of Compuserve GIF file format",
|
|
|
|
"FIXME: write help for gif_load",
|
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"1995-1997",
|
|
|
|
"<Load>/GIF",
|
|
|
|
NULL,
|
|
|
|
PROC_PLUG_IN,
|
|
|
|
nload_args, nload_return_vals,
|
|
|
|
load_args, load_return_vals);
|
|
|
|
|
|
|
|
gimp_install_procedure ("file_gif_save",
|
|
|
|
"saves files in Compuserve GIF file format",
|
|
|
|
"FIXME: write help for gif_save",
|
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"Spencer Kimball, Peter Mattis, Adam Moss, David Koblas",
|
|
|
|
"1995-1997",
|
|
|
|
"<Save>/GIF",
|
|
|
|
"INDEXED*",
|
|
|
|
PROC_PLUG_IN,
|
|
|
|
nsave_args, 0,
|
|
|
|
save_args, NULL);
|
|
|
|
|
|
|
|
gimp_register_magic_load_handler ("file_gif_load", "gif", "", "0,string,GIF8");
|
|
|
|
gimp_register_save_handler ("file_gif_save", "gif", "");
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
run (char *name,
|
|
|
|
int nparams,
|
|
|
|
GParam *param,
|
|
|
|
int *nreturn_vals,
|
|
|
|
GParam **return_vals)
|
|
|
|
{
|
|
|
|
static GParam values[2];
|
|
|
|
GStatusType status = STATUS_SUCCESS;
|
|
|
|
GRunModeType run_mode;
|
|
|
|
gint32 image_ID;
|
|
|
|
gchar **argv;
|
|
|
|
gint argc;
|
|
|
|
|
|
|
|
run_mode = param[0].data.d_int32;
|
|
|
|
|
|
|
|
*nreturn_vals = 2;
|
|
|
|
*return_vals = values;
|
|
|
|
values[0].type = PARAM_STATUS;
|
|
|
|
values[0].data.d_status = STATUS_CALLING_ERROR;
|
|
|
|
|
|
|
|
if (strcmp (name, "file_gif_load") == 0)
|
|
|
|
{
|
|
|
|
image_ID = load_image (param[1].data.d_string);
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
/* The GIF format only tells you how many bits per pixel
|
|
|
|
* are in the image, not the actual number of used indices (D'OH!)
|
|
|
|
*
|
|
|
|
* So if we're not careful, repeated load/save of a transparent GIF
|
|
|
|
* without intermediate indexed->RGB->indexed pumps up the number of
|
|
|
|
* bits used, as we add an index each time for the transparent
|
|
|
|
* colour. Ouch. We either do some heavier analysis at save-time,
|
|
|
|
* or trim down the number of GIMP colours at load-time. We do the
|
|
|
|
* latter for now.
|
|
|
|
*/
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: Highest used index is %d\n", highest_used_index);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1998-03-16 10:05:41 +00:00
|
|
|
if (!promote_to_rgb)
|
|
|
|
{
|
|
|
|
gimp_image_set_cmap (image_ID, gimp_cmap, highest_used_index+1);
|
|
|
|
}
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if (image_ID != -1)
|
|
|
|
{
|
|
|
|
values[0].data.d_status = STATUS_SUCCESS;
|
|
|
|
values[1].type = PARAM_IMAGE;
|
|
|
|
values[1].data.d_image = image_ID;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
values[0].data.d_status = STATUS_EXECUTION_ERROR;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
else if (strcmp (name, "file_gif_save") == 0)
|
|
|
|
{
|
|
|
|
argc = 1;
|
|
|
|
argv = g_new (gchar *, 1);
|
|
|
|
argv[0] = g_strdup ("gif");
|
|
|
|
|
|
|
|
gtk_init (&argc, &argv);
|
|
|
|
gtk_rc_parse (gimp_gtkrc ());
|
|
|
|
|
|
|
|
|
|
|
|
if (boundscheck(param[1].data.d_int32))
|
|
|
|
/* The image may or may not have had layers out of
|
|
|
|
bounds, but the user didn't mind cropping it down. */
|
|
|
|
{
|
|
|
|
switch (run_mode)
|
|
|
|
{
|
|
|
|
case RUN_INTERACTIVE:
|
|
|
|
{
|
|
|
|
/* Possibly retrieve data */
|
|
|
|
gimp_get_data ("file_gif_save", &gsvals);
|
|
|
|
|
|
|
|
/* First acquire information with a dialog */
|
|
|
|
radio_pressed[0] =
|
|
|
|
radio_pressed[1] =
|
|
|
|
radio_pressed[2] = FALSE;
|
|
|
|
|
|
|
|
radio_pressed[gsvals.default_dispose] = TRUE;
|
|
|
|
|
|
|
|
if (! save_dialog (param[1].data.d_int32))
|
|
|
|
{
|
|
|
|
*nreturn_vals = 1;
|
|
|
|
values[0].data.d_status = STATUS_EXECUTION_ERROR;
|
|
|
|
fflush(stdout);
|
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (radio_pressed[0]) gsvals.default_dispose = 0x00;
|
|
|
|
else
|
|
|
|
if (radio_pressed[1]) gsvals.default_dispose = 0x01;
|
|
|
|
else
|
|
|
|
if (radio_pressed[2]) gsvals.default_dispose = 0x02;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case RUN_NONINTERACTIVE:
|
|
|
|
/* Make sure all the arguments are there! */
|
|
|
|
if (nparams != 9)
|
|
|
|
status = STATUS_CALLING_ERROR;
|
|
|
|
if (status == STATUS_SUCCESS)
|
|
|
|
{
|
|
|
|
gsvals.interlace = (param[5].data.d_int32) ? TRUE : FALSE;
|
|
|
|
gsvals.loop = (param[6].data.d_int32) ? TRUE : FALSE;
|
|
|
|
gsvals.default_delay = param[7].data.d_int32;
|
|
|
|
gsvals.default_dispose = param[8].data.d_int32;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case RUN_WITH_LAST_VALS:
|
|
|
|
/* Possibly retrieve data */
|
|
|
|
gimp_get_data ("file_gif_save", &gsvals);
|
|
|
|
break;
|
|
|
|
|
|
|
|
default:
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
*nreturn_vals = 1;
|
|
|
|
if (save_image (param[3].data.d_string,
|
|
|
|
param[1].data.d_int32,
|
|
|
|
param[2].data.d_int32))
|
|
|
|
{
|
|
|
|
/* Store psvals data */
|
|
|
|
gimp_set_data ("file_gif_save", &gsvals, sizeof (GIFSaveVals));
|
|
|
|
|
|
|
|
values[0].data.d_status = STATUS_SUCCESS;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
values[0].data.d_status = STATUS_EXECUTION_ERROR;
|
|
|
|
}
|
|
|
|
else /* Some layers were out of bounds and the user wishes
|
|
|
|
to abort. */
|
|
|
|
{
|
|
|
|
*nreturn_vals = 1;
|
|
|
|
values[0].data.d_status = STATUS_EXECUTION_ERROR;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
#define MAXCOLORMAPSIZE 256
|
|
|
|
|
|
|
|
#define CM_RED 0
|
|
|
|
#define CM_GREEN 1
|
|
|
|
#define CM_BLUE 2
|
|
|
|
|
|
|
|
#define MAX_LWZ_BITS 12
|
|
|
|
|
|
|
|
#define INTERLACE 0x40
|
|
|
|
#define LOCALCOLORMAP 0x80
|
|
|
|
#define BitSet(byte, bit) (((byte) & (bit)) == (bit))
|
|
|
|
|
|
|
|
#define ReadOK(file,buffer,len) (fread(buffer, len, 1, file) != 0)
|
|
|
|
#define LM_to_uint(a,b) (((b)<<8)|(a))
|
|
|
|
|
|
|
|
#define GRAYSCALE 1
|
|
|
|
#define COLOR 2
|
|
|
|
|
|
|
|
typedef unsigned char CMap[3][MAXCOLORMAPSIZE];
|
|
|
|
|
|
|
|
static struct
|
|
|
|
{
|
|
|
|
unsigned int Width;
|
|
|
|
unsigned int Height;
|
|
|
|
CMap ColorMap;
|
|
|
|
unsigned int BitPixel;
|
|
|
|
unsigned int ColorResolution;
|
|
|
|
unsigned int Background;
|
|
|
|
unsigned int AspectRatio;
|
|
|
|
/*
|
|
|
|
**
|
|
|
|
*/
|
|
|
|
int GrayScale;
|
|
|
|
} GifScreen;
|
|
|
|
|
|
|
|
static struct
|
|
|
|
{
|
|
|
|
int transparent;
|
|
|
|
int delayTime;
|
|
|
|
int inputFlag;
|
|
|
|
int disposal;
|
|
|
|
} Gif89 = { -1, -1, -1, 0 };
|
|
|
|
|
|
|
|
int verbose = FALSE;
|
|
|
|
int showComment = TRUE;
|
|
|
|
char *globalcomment = NULL;
|
|
|
|
gint globalusecomment = TRUE;
|
|
|
|
|
|
|
|
static int ReadColorMap (FILE *, int, CMap, int *);
|
|
|
|
static int DoExtension (FILE *, int);
|
|
|
|
static int GetDataBlock (FILE *, unsigned char *);
|
|
|
|
static int GetCode (FILE *, int, int);
|
|
|
|
static int LWZReadByte (FILE *, int, int);
|
|
|
|
static gint32 ReadImage (FILE *, char *, int, int, CMap, int, int, int, int,
|
|
|
|
guint, guint, guint, guint);
|
|
|
|
|
|
|
|
|
|
|
|
static gint32
|
|
|
|
load_image (char *filename)
|
|
|
|
{
|
|
|
|
FILE *fd;
|
|
|
|
char * name_buf;
|
|
|
|
unsigned char buf[16];
|
|
|
|
unsigned char c;
|
|
|
|
CMap localColorMap;
|
|
|
|
int grayScale;
|
|
|
|
int useGlobalColormap;
|
|
|
|
int bitPixel;
|
|
|
|
int imageCount = 0;
|
|
|
|
char version[4];
|
|
|
|
gint32 image_ID = -1;
|
|
|
|
|
|
|
|
fd = fopen (filename, "rb");
|
|
|
|
if (!fd)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: can't open \"%s\"\n", filename);
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
name_buf = g_malloc (strlen (filename) + 11);
|
|
|
|
|
|
|
|
sprintf (name_buf, "Loading %s:", filename);
|
|
|
|
gimp_progress_init (name_buf);
|
|
|
|
g_free (name_buf);
|
|
|
|
|
|
|
|
if (!ReadOK (fd, buf, 6))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error reading magic number\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (strncmp ((char *) buf, "GIF", 3) != 0)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: not a GIF file\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
strncpy (version, (char *) buf + 3, 3);
|
|
|
|
version[3] = '\0';
|
|
|
|
|
|
|
|
if ((strcmp (version, "87a") != 0) && (strcmp (version, "89a") != 0))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: bad version number, not '87a' or '89a'\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (!ReadOK (fd, buf, 7))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: failed to read screen descriptor\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
GifScreen.Width = LM_to_uint (buf[0], buf[1]);
|
|
|
|
GifScreen.Height = LM_to_uint (buf[2], buf[3]);
|
|
|
|
GifScreen.BitPixel = 2 << (buf[4] & 0x07);
|
|
|
|
GifScreen.ColorResolution = (((buf[4] & 0x70) >> 3) + 1);
|
|
|
|
GifScreen.Background = buf[5];
|
|
|
|
GifScreen.AspectRatio = buf[6];
|
|
|
|
|
|
|
|
if (BitSet (buf[4], LOCALCOLORMAP))
|
|
|
|
{
|
|
|
|
/* Global Colormap */
|
|
|
|
if (ReadColorMap (fd, GifScreen.BitPixel, GifScreen.ColorMap, &GifScreen.GrayScale))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error reading global colormap\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if (GifScreen.AspectRatio != 0 && GifScreen.AspectRatio != 49)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: warning - non-square pixels\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
|
|
|
|
highest_used_index = 0;
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
for (;;)
|
|
|
|
{
|
|
|
|
if (!ReadOK (fd, &c, 1))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: EOF / read error on image data\n");
|
1998-05-21 20:26:06 +00:00
|
|
|
return image_ID; /* will be -1 if failed on first image! */
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
if (c == ';')
|
|
|
|
{
|
|
|
|
/* GIF terminator */
|
|
|
|
return image_ID;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (c == '!')
|
|
|
|
{
|
|
|
|
/* Extension */
|
|
|
|
if (!ReadOK (fd, &c, 1))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: OF / read error on extention function code\n");
|
1998-05-21 20:26:06 +00:00
|
|
|
return image_ID; /* will be -1 if failed on first image! */
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
DoExtension (fd, c);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (c != ',')
|
|
|
|
{
|
|
|
|
/* Not a valid start character */
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: bogus character 0x%02x, ignoring\n", (int) c);
|
1997-11-24 22:05:25 +00:00
|
|
|
continue;
|
|
|
|
}
|
|
|
|
|
|
|
|
++imageCount;
|
|
|
|
|
|
|
|
if (!ReadOK (fd, buf, 9))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: couldn't read left/top/width/height\n");
|
1998-05-21 20:26:06 +00:00
|
|
|
return image_ID; /* will be -1 if failed on first image! */
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
useGlobalColormap = !BitSet (buf[8], LOCALCOLORMAP);
|
|
|
|
|
|
|
|
bitPixel = 1 << ((buf[8] & 0x07) + 1);
|
|
|
|
|
|
|
|
if (!useGlobalColormap)
|
|
|
|
{
|
|
|
|
if (ReadColorMap (fd, bitPixel, localColorMap, &grayScale))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error reading local colormap\n");
|
1998-05-21 20:26:06 +00:00
|
|
|
return image_ID; /* will be -1 if failed on first image! */
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
image_ID = ReadImage (fd, filename, LM_to_uint (buf[4], buf[5]),
|
|
|
|
LM_to_uint (buf[6], buf[7]),
|
|
|
|
localColorMap, bitPixel,
|
|
|
|
grayScale,
|
|
|
|
BitSet (buf[8], INTERLACE), imageCount,
|
|
|
|
(guint) LM_to_uint (buf[0], buf[1]),
|
|
|
|
(guint) LM_to_uint (buf[2], buf[3]),
|
|
|
|
GifScreen.Width,
|
|
|
|
GifScreen.Height
|
|
|
|
);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
image_ID = ReadImage (fd, filename, LM_to_uint (buf[4], buf[5]),
|
|
|
|
LM_to_uint (buf[6], buf[7]),
|
|
|
|
GifScreen.ColorMap, GifScreen.BitPixel,
|
|
|
|
GifScreen.GrayScale,
|
|
|
|
BitSet (buf[8], INTERLACE), imageCount,
|
|
|
|
(guint) LM_to_uint (buf[0], buf[1]),
|
|
|
|
(guint) LM_to_uint (buf[2], buf[3]),
|
|
|
|
GifScreen.Width,
|
|
|
|
GifScreen.Height
|
|
|
|
);
|
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
if (comment_parasite != NULL)
|
|
|
|
{
|
|
|
|
gimp_image_attach_parasite (image_ID, comment_parasite);
|
|
|
|
gparasite_free (comment_parasite);
|
|
|
|
comment_parasite = NULL;
|
|
|
|
}
|
|
|
|
#endif
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
return image_ID;
|
|
|
|
}
|
|
|
|
|
|
|
|
static int
|
|
|
|
ReadColorMap (FILE *fd,
|
|
|
|
int number,
|
|
|
|
CMap buffer,
|
|
|
|
int *format)
|
|
|
|
{
|
|
|
|
int i;
|
|
|
|
unsigned char rgb[3];
|
|
|
|
int flag;
|
|
|
|
|
|
|
|
flag = TRUE;
|
|
|
|
|
|
|
|
for (i = 0; i < number; ++i)
|
|
|
|
{
|
|
|
|
if (!ReadOK (fd, rgb, sizeof (rgb)))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: bad colormap\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
buffer[CM_RED][i] = rgb[0];
|
|
|
|
buffer[CM_GREEN][i] = rgb[1];
|
|
|
|
buffer[CM_BLUE][i] = rgb[2];
|
|
|
|
|
|
|
|
flag &= (rgb[0] == rgb[1] && rgb[1] == rgb[2]);
|
|
|
|
}
|
|
|
|
|
|
|
|
*format = (flag) ? GRAYSCALE : COLOR;
|
|
|
|
|
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
|
|
|
|
static int
|
|
|
|
DoExtension (FILE *fd,
|
|
|
|
int label)
|
|
|
|
{
|
|
|
|
static guchar buf[256];
|
|
|
|
char *str;
|
|
|
|
|
|
|
|
switch (label)
|
|
|
|
{
|
|
|
|
case 0x01: /* Plain Text Extension */
|
|
|
|
str = "Plain Text Extension";
|
|
|
|
#ifdef notdef
|
|
|
|
if (GetDataBlock (fd, (unsigned char *) buf) == 0)
|
|
|
|
;
|
|
|
|
|
|
|
|
lpos = LM_to_uint (buf[0], buf[1]);
|
|
|
|
tpos = LM_to_uint (buf[2], buf[3]);
|
|
|
|
width = LM_to_uint (buf[4], buf[5]);
|
|
|
|
height = LM_to_uint (buf[6], buf[7]);
|
|
|
|
cellw = buf[8];
|
|
|
|
cellh = buf[9];
|
|
|
|
foreground = buf[10];
|
|
|
|
background = buf[11];
|
|
|
|
|
|
|
|
while (GetDataBlock (fd, (unsigned char *) buf) != 0)
|
|
|
|
{
|
|
|
|
PPM_ASSIGN (image[ypos][xpos],
|
|
|
|
cmap[CM_RED][v],
|
|
|
|
cmap[CM_GREEN][v],
|
|
|
|
cmap[CM_BLUE][v]);
|
|
|
|
++index;
|
|
|
|
}
|
|
|
|
|
|
|
|
return FALSE;
|
|
|
|
#else
|
|
|
|
break;
|
|
|
|
#endif
|
|
|
|
case 0xff: /* Application Extension */
|
|
|
|
str = "Application Extension";
|
|
|
|
break;
|
|
|
|
case 0xfe: /* Comment Extension */
|
|
|
|
str = "Comment Extension";
|
|
|
|
while (GetDataBlock (fd, (unsigned char *) buf) != 0)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
if (comment_parasite != NULL)
|
|
|
|
{
|
|
|
|
gparasite_free (comment_parasite);
|
|
|
|
}
|
|
|
|
|
|
|
|
comment_parasite = gparasite_new ("GIF2","CMNT",TRUE,
|
|
|
|
strlen(buf)+1, (void*)buf);
|
|
|
|
#else
|
1997-11-24 22:05:25 +00:00
|
|
|
if (showComment)
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: gif comment: %s\n", buf);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
1998-10-09 18:01:35 +00:00
|
|
|
return TRUE;
|
|
|
|
break;
|
1997-11-24 22:05:25 +00:00
|
|
|
case 0xf9: /* Graphic Control Extension */
|
|
|
|
str = "Graphic Control Extension";
|
|
|
|
(void) GetDataBlock (fd, (unsigned char *) buf);
|
|
|
|
Gif89.disposal = (buf[0] >> 2) & 0x7;
|
|
|
|
Gif89.inputFlag = (buf[0] >> 1) & 0x1;
|
|
|
|
Gif89.delayTime = LM_to_uint (buf[1], buf[2]);
|
|
|
|
if ((buf[0] & 0x1) != 0)
|
|
|
|
Gif89.transparent = buf[3];
|
1998-03-17 09:39:40 +00:00
|
|
|
else
|
|
|
|
Gif89.transparent = -1;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
while (GetDataBlock (fd, (unsigned char *) buf) != 0)
|
|
|
|
;
|
|
|
|
return FALSE;
|
1998-10-09 18:01:35 +00:00
|
|
|
break;
|
1997-11-24 22:05:25 +00:00
|
|
|
default:
|
1998-03-19 02:11:53 +00:00
|
|
|
str = (char *)buf;
|
|
|
|
sprintf ((char *)buf, "UNKNOWN (0x%02x)", label);
|
1997-11-24 22:05:25 +00:00
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
|
|
|
g_print ("GIF: got a '%s'\n", str);
|
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
while (GetDataBlock (fd, (unsigned char *) buf) != 0)
|
|
|
|
;
|
|
|
|
|
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
|
|
|
|
int ZeroDataBlock = FALSE;
|
|
|
|
|
|
|
|
static int
|
|
|
|
GetDataBlock (FILE *fd,
|
|
|
|
unsigned char *buf)
|
|
|
|
{
|
|
|
|
unsigned char count;
|
|
|
|
|
|
|
|
if (!ReadOK (fd, &count, 1))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error in getting DataBlock size\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
ZeroDataBlock = count == 0;
|
|
|
|
|
|
|
|
if ((count != 0) && (!ReadOK (fd, buf, count)))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error in reading DataBlock\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
return count;
|
|
|
|
}
|
|
|
|
|
|
|
|
static int
|
|
|
|
GetCode (FILE *fd,
|
|
|
|
int code_size,
|
|
|
|
int flag)
|
|
|
|
{
|
|
|
|
static unsigned char buf[280];
|
|
|
|
static int curbit, lastbit, done, last_byte;
|
|
|
|
int i, j, ret;
|
|
|
|
unsigned char count;
|
|
|
|
|
|
|
|
if (flag)
|
|
|
|
{
|
|
|
|
curbit = 0;
|
|
|
|
lastbit = 0;
|
|
|
|
done = FALSE;
|
|
|
|
return 0;
|
|
|
|
}
|
|
|
|
|
|
|
|
if ((curbit + code_size) >= lastbit)
|
|
|
|
{
|
|
|
|
if (done)
|
|
|
|
{
|
|
|
|
if (curbit >= lastbit)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: ran off the end of by bits\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
gimp_quit ();
|
|
|
|
}
|
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
buf[0] = buf[last_byte - 2];
|
|
|
|
buf[1] = buf[last_byte - 1];
|
|
|
|
|
|
|
|
if ((count = GetDataBlock (fd, &buf[2])) == 0)
|
|
|
|
done = TRUE;
|
|
|
|
|
|
|
|
last_byte = 2 + count;
|
|
|
|
curbit = (curbit - lastbit) + 16;
|
|
|
|
lastbit = (2 + count) * 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
ret = 0;
|
|
|
|
for (i = curbit, j = 0; j < code_size; ++i, ++j)
|
|
|
|
ret |= ((buf[i / 8] & (1 << (i % 8))) != 0) << j;
|
|
|
|
|
|
|
|
curbit += code_size;
|
|
|
|
|
|
|
|
return ret;
|
|
|
|
}
|
|
|
|
|
|
|
|
static int
|
|
|
|
LWZReadByte (FILE *fd,
|
|
|
|
int flag,
|
|
|
|
int input_code_size)
|
|
|
|
{
|
|
|
|
static int fresh = FALSE;
|
|
|
|
int code, incode;
|
|
|
|
static int code_size, set_code_size;
|
|
|
|
static int max_code, max_code_size;
|
|
|
|
static int firstcode, oldcode;
|
|
|
|
static int clear_code, end_code;
|
|
|
|
static int table[2][(1 << MAX_LWZ_BITS)];
|
|
|
|
static int stack[(1 << (MAX_LWZ_BITS)) * 2], *sp;
|
|
|
|
register int i;
|
|
|
|
|
|
|
|
if (flag)
|
|
|
|
{
|
|
|
|
set_code_size = input_code_size;
|
|
|
|
code_size = set_code_size + 1;
|
|
|
|
clear_code = 1 << set_code_size;
|
|
|
|
end_code = clear_code + 1;
|
|
|
|
max_code_size = 2 * clear_code;
|
|
|
|
max_code = clear_code + 2;
|
|
|
|
|
|
|
|
GetCode (fd, 0, TRUE);
|
|
|
|
|
|
|
|
fresh = TRUE;
|
|
|
|
|
|
|
|
for (i = 0; i < clear_code; ++i)
|
|
|
|
{
|
|
|
|
table[0][i] = 0;
|
|
|
|
table[1][i] = i;
|
|
|
|
}
|
|
|
|
for (; i < (1 << MAX_LWZ_BITS); ++i)
|
|
|
|
table[0][i] = table[1][0] = 0;
|
|
|
|
|
|
|
|
sp = stack;
|
|
|
|
|
|
|
|
return 0;
|
|
|
|
}
|
|
|
|
else if (fresh)
|
|
|
|
{
|
|
|
|
fresh = FALSE;
|
|
|
|
do
|
|
|
|
{
|
|
|
|
firstcode = oldcode =
|
|
|
|
GetCode (fd, code_size, FALSE);
|
|
|
|
}
|
|
|
|
while (firstcode == clear_code);
|
|
|
|
return firstcode;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (sp > stack)
|
|
|
|
return *--sp;
|
|
|
|
|
|
|
|
while ((code = GetCode (fd, code_size, FALSE)) >= 0)
|
|
|
|
{
|
|
|
|
if (code == clear_code)
|
|
|
|
{
|
|
|
|
for (i = 0; i < clear_code; ++i)
|
|
|
|
{
|
|
|
|
table[0][i] = 0;
|
|
|
|
table[1][i] = i;
|
|
|
|
}
|
|
|
|
for (; i < (1 << MAX_LWZ_BITS); ++i)
|
|
|
|
table[0][i] = table[1][i] = 0;
|
|
|
|
code_size = set_code_size + 1;
|
|
|
|
max_code_size = 2 * clear_code;
|
|
|
|
max_code = clear_code + 2;
|
|
|
|
sp = stack;
|
|
|
|
firstcode = oldcode =
|
|
|
|
GetCode (fd, code_size, FALSE);
|
|
|
|
return firstcode;
|
|
|
|
}
|
|
|
|
else if (code == end_code)
|
|
|
|
{
|
|
|
|
int count;
|
|
|
|
unsigned char buf[260];
|
|
|
|
|
|
|
|
if (ZeroDataBlock)
|
|
|
|
return -2;
|
|
|
|
|
|
|
|
while ((count = GetDataBlock (fd, buf)) > 0)
|
|
|
|
;
|
|
|
|
|
|
|
|
if (count != 0)
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: missing EOD in data stream (common occurence)");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -2;
|
|
|
|
}
|
|
|
|
|
|
|
|
incode = code;
|
|
|
|
|
|
|
|
if (code >= max_code)
|
|
|
|
{
|
|
|
|
*sp++ = firstcode;
|
|
|
|
code = oldcode;
|
|
|
|
}
|
|
|
|
|
|
|
|
while (code >= clear_code)
|
|
|
|
{
|
|
|
|
*sp++ = table[1][code];
|
|
|
|
if (code == table[0][code])
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: circular table entry BIG ERROR\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
gimp_quit ();
|
|
|
|
}
|
|
|
|
code = table[0][code];
|
|
|
|
}
|
|
|
|
|
|
|
|
*sp++ = firstcode = table[1][code];
|
|
|
|
|
|
|
|
if ((code = max_code) < (1 << MAX_LWZ_BITS))
|
|
|
|
{
|
|
|
|
table[0][code] = oldcode;
|
|
|
|
table[1][code] = firstcode;
|
|
|
|
++max_code;
|
|
|
|
if ((max_code >= max_code_size) &&
|
|
|
|
(max_code_size < (1 << MAX_LWZ_BITS)))
|
|
|
|
{
|
|
|
|
max_code_size *= 2;
|
|
|
|
++code_size;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
oldcode = incode;
|
|
|
|
|
|
|
|
if (sp > stack)
|
|
|
|
return *--sp;
|
|
|
|
}
|
|
|
|
return code;
|
|
|
|
}
|
|
|
|
|
|
|
|
static gint32
|
|
|
|
ReadImage (FILE *fd,
|
|
|
|
char *filename,
|
|
|
|
int len,
|
|
|
|
int height,
|
|
|
|
CMap cmap,
|
|
|
|
int ncols,
|
|
|
|
int format,
|
|
|
|
int interlace,
|
|
|
|
int number,
|
|
|
|
guint leftpos,
|
|
|
|
guint toppos,
|
|
|
|
guint screenwidth,
|
|
|
|
guint screenheight)
|
|
|
|
{
|
|
|
|
static gint32 image_ID;
|
|
|
|
static gint frame_number = 1;
|
|
|
|
|
|
|
|
gint32 layer_ID;
|
|
|
|
GPixelRgn pixel_rgn;
|
|
|
|
GDrawable *drawable;
|
|
|
|
guchar *dest, *temp;
|
|
|
|
guchar c;
|
|
|
|
gint xpos = 0, ypos = 0, pass = 0;
|
|
|
|
gint cur_progress, max_progress;
|
|
|
|
gint v;
|
|
|
|
gint i, j;
|
|
|
|
gchar framename[200]; /* FIXME */
|
|
|
|
gboolean alpha_frame = FALSE;
|
|
|
|
int nreturn_vals;
|
1997-12-12 10:01:21 +00:00
|
|
|
static int previous_disposal;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
** Initialize the Compression routines
|
|
|
|
*/
|
|
|
|
if (!ReadOK (fd, &c, 1))
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: EOF / read error on image data\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (LWZReadByte (fd, TRUE, c) < 0)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error while reading\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return -1;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (frame_number == 1 )
|
|
|
|
{
|
|
|
|
image_ID = gimp_image_new (screenwidth, screenheight, INDEXED);
|
|
|
|
gimp_image_set_filename (image_ID, filename);
|
|
|
|
|
|
|
|
for (i = 0, j = 0; i < ncols; i++)
|
|
|
|
{
|
|
|
|
used_cmap[0][i] = gimp_cmap[j++] = cmap[0][i];
|
|
|
|
used_cmap[1][i] = gimp_cmap[j++] = cmap[1][i];
|
|
|
|
used_cmap[2][i] = gimp_cmap[j++] = cmap[2][i];
|
|
|
|
}
|
|
|
|
|
|
|
|
gimp_image_set_cmap (image_ID, gimp_cmap, ncols);
|
|
|
|
|
|
|
|
if (Gif89.delayTime < 0)
|
|
|
|
strcpy(framename, "Background");
|
|
|
|
else
|
|
|
|
sprintf(framename, "Background (%dms)", 10*Gif89.delayTime);
|
|
|
|
|
1997-12-12 10:01:21 +00:00
|
|
|
previous_disposal = Gif89.disposal;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if (Gif89.transparent == -1)
|
|
|
|
{
|
|
|
|
layer_ID = gimp_layer_new (image_ID, framename,
|
|
|
|
len, height,
|
|
|
|
INDEXED_IMAGE, 100, NORMAL_MODE);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
layer_ID = gimp_layer_new (image_ID, framename,
|
|
|
|
len, height,
|
|
|
|
INDEXEDA_IMAGE, 100, NORMAL_MODE);
|
|
|
|
alpha_frame=TRUE;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
else /* NOT FIRST FRAME */
|
|
|
|
{
|
|
|
|
/* If the colourmap is now different, we have to promote to
|
|
|
|
RGB! */
|
|
|
|
if (!promote_to_rgb)
|
|
|
|
{
|
|
|
|
for (i=0;i<ncols;i++)
|
|
|
|
{
|
|
|
|
if (
|
|
|
|
(used_cmap[0][i] != cmap[0][i]) ||
|
|
|
|
(used_cmap[1][i] != cmap[1][i]) ||
|
|
|
|
(used_cmap[2][i] != cmap[2][i])
|
|
|
|
)
|
|
|
|
{ /* Everything is RGB(A) from now on... sigh. */
|
|
|
|
promote_to_rgb = TRUE;
|
|
|
|
|
|
|
|
/* Promote everything we have so far into RGB(A) */
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: Promoting image to RGB...\n");
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
gimp_run_procedure("gimp_convert_rgb", &nreturn_vals,
|
|
|
|
PARAM_IMAGE, image_ID,
|
|
|
|
PARAM_END);
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if (Gif89.delayTime < 0)
|
|
|
|
sprintf(framename, "Frame %d", frame_number);
|
|
|
|
else
|
|
|
|
sprintf(framename, "Frame %d (%dms)",
|
|
|
|
frame_number, 10*Gif89.delayTime);
|
|
|
|
|
1997-12-12 10:01:21 +00:00
|
|
|
switch (previous_disposal)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
case 0x00: break; /* 'don't care' */
|
|
|
|
case 0x01: strcat(framename," (combine)"); break;
|
|
|
|
case 0x02: strcat(framename," (replace)"); break;
|
|
|
|
case 0x03: strcat(framename," (combine)"); break;
|
|
|
|
case 0x04:
|
|
|
|
case 0x05:
|
|
|
|
case 0x06:
|
|
|
|
case 0x07:
|
|
|
|
strcat(framename," (unknown disposal)");
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: Hmm... please forward this GIF to the "
|
|
|
|
"GIF plugin author!\n (adam@foxbox.org)\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
break;
|
1998-05-30 07:32:37 +00:00
|
|
|
default: g_message ("GIF: Something got corrupted.\n"); break;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
1997-12-12 10:01:21 +00:00
|
|
|
previous_disposal = Gif89.disposal;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
layer_ID = gimp_layer_new (image_ID, framename,
|
|
|
|
len, height,
|
|
|
|
promote_to_rgb ? RGBA_IMAGE : INDEXEDA_IMAGE,
|
|
|
|
100, NORMAL_MODE);
|
|
|
|
alpha_frame = TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
frame_number++;
|
|
|
|
|
|
|
|
gimp_image_add_layer (image_ID, layer_ID, 0);
|
|
|
|
gimp_layer_translate (layer_ID, (gint)leftpos, (gint)toppos);
|
|
|
|
|
|
|
|
drawable = gimp_drawable_get (layer_ID);
|
|
|
|
|
|
|
|
cur_progress = 0;
|
|
|
|
max_progress = height;
|
|
|
|
|
|
|
|
if (alpha_frame)
|
|
|
|
dest = (guchar *) g_malloc (len * height *
|
|
|
|
(promote_to_rgb ? 4 : 2));
|
|
|
|
else
|
|
|
|
dest = (guchar *) g_malloc (len * height);
|
|
|
|
|
|
|
|
if (verbose)
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: reading %d by %d%s GIF image, ncols=%d\n",
|
|
|
|
len, height, interlace ? " interlaced" : "", ncols);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
if (!alpha_frame && promote_to_rgb)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: Ouchie! Can't handle non-alpha RGB frames.\n Please mail the plugin author. (adam@gimp.org)\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
exit(-1);
|
|
|
|
}
|
|
|
|
|
|
|
|
while ((v = LWZReadByte (fd, FALSE, c)) >= 0)
|
|
|
|
{
|
|
|
|
if (alpha_frame)
|
|
|
|
{
|
1998-03-16 10:05:41 +00:00
|
|
|
if (((guchar)v > highest_used_index) && !(v == Gif89.transparent))
|
|
|
|
highest_used_index = (guchar)v;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
if (promote_to_rgb)
|
|
|
|
{
|
|
|
|
temp = dest + ( (ypos * len) + xpos ) * 4;
|
|
|
|
*(temp ) = (guchar) cmap[0][v];
|
|
|
|
*(temp+1) = (guchar) cmap[1][v];
|
|
|
|
*(temp+2) = (guchar) cmap[2][v];
|
|
|
|
*(temp+3) = (guchar) ((v == Gif89.transparent) ? 0 : 255);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
temp = dest + ( (ypos * len) + xpos ) * 2;
|
|
|
|
*temp = (guchar) v;
|
1998-03-16 10:05:41 +00:00
|
|
|
*(temp+1) = (guchar) ((v == Gif89.transparent) ? 0 : 255);
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
1998-03-16 10:05:41 +00:00
|
|
|
if ((guchar)v > highest_used_index)
|
|
|
|
highest_used_index = (guchar)v;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
temp = dest + (ypos * len) + xpos;
|
|
|
|
*temp = (guchar) v;
|
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
xpos++;
|
1997-11-24 22:05:25 +00:00
|
|
|
if (xpos == len)
|
|
|
|
{
|
|
|
|
xpos = 0;
|
|
|
|
if (interlace)
|
|
|
|
{
|
|
|
|
switch (pass)
|
|
|
|
{
|
|
|
|
case 0:
|
|
|
|
case 1:
|
|
|
|
ypos += 8;
|
|
|
|
break;
|
|
|
|
case 2:
|
|
|
|
ypos += 4;
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
ypos += 2;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (ypos >= height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
switch (pass)
|
|
|
|
{
|
|
|
|
case 1:
|
|
|
|
ypos = 4;
|
|
|
|
break;
|
|
|
|
case 2:
|
|
|
|
ypos = 2;
|
|
|
|
break;
|
|
|
|
case 3:
|
|
|
|
ypos = 1;
|
|
|
|
break;
|
|
|
|
default:
|
|
|
|
goto fini;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
ypos++;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
cur_progress++;
|
|
|
|
if ((cur_progress % 16) == 0)
|
|
|
|
gimp_progress_update ((double) cur_progress / (double) max_progress);
|
|
|
|
}
|
|
|
|
if (ypos >= height)
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
fini:
|
|
|
|
if (LWZReadByte (fd, FALSE, c) >= 0)
|
1998-05-30 07:32:37 +00:00
|
|
|
g_print ("GIF: too much input data, ignoring extra...\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
gimp_pixel_rgn_init (&pixel_rgn, drawable, 0, 0, drawable->width, drawable->height, TRUE, FALSE);
|
|
|
|
gimp_pixel_rgn_set_rect (&pixel_rgn, dest, 0, 0, drawable->width, drawable->height);
|
|
|
|
|
|
|
|
g_free (dest);
|
|
|
|
|
|
|
|
gimp_drawable_flush (drawable);
|
|
|
|
gimp_drawable_detach (drawable);
|
|
|
|
|
|
|
|
return image_ID;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* ppmtogif.c - read a portable pixmap and produce a GIF file
|
|
|
|
**
|
|
|
|
** Based on GIFENCOD by David Rowley <mgardi@watdscu.waterloo.edu>.A
|
|
|
|
** Lempel-Zim compression based on "compress".
|
|
|
|
**
|
|
|
|
** Modified by Marcel Wijkstra <wijkstra@fwi.uva.nl>
|
|
|
|
**
|
|
|
|
**
|
|
|
|
** Copyright (C) 1989 by Jef Poskanzer.
|
|
|
|
**
|
|
|
|
** Permission to use, copy, modify, and distribute this software and its
|
|
|
|
** documentation for any purpose and without fee is hereby granted, provided
|
|
|
|
** that the above copyright notice appear in all copies and that both that
|
|
|
|
** copyright notice and this permission notice appear in supporting
|
|
|
|
** documentation. This software is provided "as is" without express or
|
|
|
|
** implied warranty.
|
|
|
|
**
|
|
|
|
** The Graphics Interchange Format(c) is the Copyright property of
|
|
|
|
** CompuServe Incorporated. GIF(sm) is a Service Mark property of
|
|
|
|
** CompuServe Incorporated.
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define MAXCOLORS 256
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Pointer to function returning an int
|
|
|
|
*/
|
|
|
|
typedef int (*ifunptr) (int, int);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* a code_int must be able to hold 2**BITS values of type int, and also -1
|
|
|
|
*/
|
|
|
|
typedef int code_int;
|
|
|
|
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
typedef unsigned long int count_int;
|
|
|
|
typedef unsigned short int count_short;
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
typedef long int count_int;
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
static int find_unused_ia_colour (guchar *pixels,
|
1998-09-15 20:34:30 +00:00
|
|
|
int numpixels,
|
|
|
|
int num_indices,
|
|
|
|
int* colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
void special_flatten_indexed_alpha (guchar *pixels,
|
|
|
|
int *transparent,
|
|
|
|
int *colors,
|
|
|
|
int numpixels);
|
|
|
|
static int colorstobpp (int);
|
1998-09-15 20:34:30 +00:00
|
|
|
static int bpptocolors (int);
|
1997-11-24 22:05:25 +00:00
|
|
|
static int GetPixel (int, int);
|
|
|
|
static void BumpPixel (void);
|
|
|
|
static int GIFNextPixel (ifunptr);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
static void GIFEncodeHeader (FILE *, gboolean, int, int, int, int,
|
1997-11-24 22:05:25 +00:00
|
|
|
int *, int *, int *, ifunptr);
|
1998-10-09 18:01:35 +00:00
|
|
|
static void GIFEncodeGraphicControlExt (FILE *, int, int, int, int, int,
|
1997-11-24 22:05:25 +00:00
|
|
|
int, int, int, int *, int *, int *,
|
|
|
|
ifunptr);
|
|
|
|
static void GIFEncodeImageData (FILE *, int, int, int, int, int, int,
|
|
|
|
int *, int *, int *, ifunptr, gint, gint);
|
|
|
|
static void GIFEncodeClose (FILE *, int, int, int, int, int, int,
|
|
|
|
int *, int *, int *, ifunptr);
|
1998-10-09 18:01:35 +00:00
|
|
|
static void GIFEncodeLoopExt (FILE *, guint);
|
1997-11-24 22:05:25 +00:00
|
|
|
static void GIFEncodeCommentExt (FILE *, char *);
|
|
|
|
|
|
|
|
int rowstride;
|
|
|
|
guchar *pixels;
|
|
|
|
int cur_progress;
|
|
|
|
int max_progress;
|
|
|
|
|
|
|
|
static void Putword (int, FILE *);
|
|
|
|
static void compress (int, FILE *, ifunptr);
|
|
|
|
static void output (code_int);
|
|
|
|
static void cl_block (void);
|
|
|
|
static void cl_hash (count_int);
|
|
|
|
static void writeerr (void);
|
|
|
|
static void char_init (void);
|
|
|
|
static void char_out (int);
|
|
|
|
static void flush_char (void);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
static int find_unused_ia_colour (guchar *pixels,
|
1998-09-15 20:34:30 +00:00
|
|
|
int numpixels,
|
|
|
|
int num_indices,
|
|
|
|
int* colors)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
int i;
|
|
|
|
gboolean ix_used[256];
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
1998-09-15 20:34:30 +00:00
|
|
|
g_print ("GIF: fuiac: Image claims to use %d/%d indices - finding free "
|
|
|
|
"index...\n", (int)(*colors),(int)num_indices);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=0; i<256; i++)
|
|
|
|
{
|
|
|
|
ix_used[i] = (gboolean)FALSE;
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
{
|
|
|
|
if (pixels[i*2+1]) ix_used[pixels[i*2]] = (gboolean)TRUE;
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
for (i=num_indices-1; i>=0; i--)
|
|
|
|
{
|
|
|
|
if (ix_used[i] == (gboolean)FALSE)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
1998-09-15 20:34:30 +00:00
|
|
|
g_print ("GIF: Found unused colour index %d.\n",(int)i);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
1998-09-15 20:34:30 +00:00
|
|
|
return i;
|
|
|
|
}
|
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
/* Couldn't find an unused colour index within the number of
|
|
|
|
bits per pixel we wanted. Will have to increment the number
|
|
|
|
of colours in the image and assign a transparent pixel there. */
|
|
|
|
if ((*colors) < 256)
|
|
|
|
{
|
|
|
|
(*colors)++;
|
|
|
|
g_print ("GIF: 2nd pass - Increasing bounds and using colour index %d.\n"
|
|
|
|
, (int) (*colors)-1);
|
|
|
|
return ((*colors)-1);
|
|
|
|
}
|
|
|
|
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: Couldn't simply reduce colours further. Saving as opaque.\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return (-1);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
void
|
|
|
|
special_flatten_indexed_alpha (guchar *pixels,
|
|
|
|
int *transparent,
|
|
|
|
int *colors,
|
|
|
|
int numpixels)
|
|
|
|
{
|
|
|
|
guint32 i;
|
|
|
|
|
|
|
|
/* Each transparent pixel in the image is mapped to a uniform value for
|
|
|
|
encoding, if image already has <=255 colours */
|
|
|
|
|
|
|
|
if ((*transparent) == -1) /* tough, no indices left for the trans. index */
|
|
|
|
{
|
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
pixels[i] = pixels[i*2];
|
|
|
|
}
|
|
|
|
else /* make transparent */
|
|
|
|
{
|
|
|
|
for (i=0; i<numpixels; i++)
|
|
|
|
{
|
|
|
|
if (!(pixels[i*2+1] & 128))
|
|
|
|
{
|
|
|
|
pixels[i] = (guchar)(*transparent);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
pixels[i] = pixels[i*2];
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* Pixel data now takes half as much space (the alpha data has been
|
|
|
|
discarded) */
|
1998-09-15 20:34:30 +00:00
|
|
|
/* pixels = g_realloc (pixels, numpixels);*/
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
int
|
|
|
|
parse_ms_tag (char *str)
|
|
|
|
{
|
|
|
|
gint sum = 0;
|
|
|
|
gint offset = 0;
|
|
|
|
gint length;
|
|
|
|
|
|
|
|
length = strlen(str);
|
|
|
|
|
1998-04-29 10:48:02 +00:00
|
|
|
find_another_bra:
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
while ((offset<length) && (str[offset]!='('))
|
|
|
|
offset++;
|
|
|
|
|
|
|
|
if (offset>=length)
|
|
|
|
return(-1);
|
|
|
|
|
|
|
|
if (!isdigit(str[++offset]))
|
1998-04-29 10:48:02 +00:00
|
|
|
goto find_another_bra;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
do
|
|
|
|
{
|
|
|
|
sum *= 10;
|
|
|
|
sum += str[offset] - '0';
|
|
|
|
offset++;
|
|
|
|
}
|
|
|
|
while ((offset<length) && (isdigit(str[offset])));
|
|
|
|
|
|
|
|
if (length-offset <= 2)
|
|
|
|
return(-3);
|
|
|
|
|
|
|
|
if ((toupper(str[offset]) != 'M') || (toupper(str[offset+1]) != 'S'))
|
|
|
|
return(-4);
|
|
|
|
|
|
|
|
return (sum);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
int
|
|
|
|
parse_disposal_tag (char *str)
|
|
|
|
{
|
|
|
|
gint offset = 0;
|
|
|
|
gint length;
|
|
|
|
|
|
|
|
length = strlen(str);
|
|
|
|
|
|
|
|
while ((offset+9)<=length)
|
|
|
|
{
|
|
|
|
if (strncmp(&str[offset],"(combine)",9)==0)
|
|
|
|
return(0x01);
|
|
|
|
if (strncmp(&str[offset],"(replace)",9)==0)
|
|
|
|
return(0x02);
|
|
|
|
offset++;
|
|
|
|
}
|
|
|
|
|
|
|
|
return (gsvals.default_dispose);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gboolean
|
|
|
|
boundscheck (gint32 image_ID)
|
|
|
|
{
|
|
|
|
GDrawable *drawable;
|
|
|
|
gint32 *layers;
|
|
|
|
gint nlayers;
|
|
|
|
gint nreturn_vals;
|
|
|
|
gint i;
|
|
|
|
gint offset_x, offset_y;
|
|
|
|
|
|
|
|
/* get a list of layers for this image_ID */
|
|
|
|
layers = gimp_image_get_layers (image_ID, &nlayers);
|
|
|
|
|
|
|
|
|
|
|
|
/*** Iterate through the layers to make sure they're all ***/
|
|
|
|
/*** within the bounds of the image ***/
|
|
|
|
|
|
|
|
for (i=0;i<nlayers;i++)
|
|
|
|
{
|
|
|
|
drawable = gimp_drawable_get (layers[i]);
|
|
|
|
gimp_drawable_offsets (layers[i], &offset_x, &offset_y);
|
|
|
|
|
|
|
|
if ((offset_x < 0) ||
|
|
|
|
(offset_y < 0) ||
|
|
|
|
(offset_x+drawable->width > gimp_image_width(image_ID)) ||
|
|
|
|
(offset_y+drawable->height > gimp_image_height(image_ID)))
|
|
|
|
{
|
|
|
|
g_free (layers);
|
|
|
|
gimp_drawable_detach(drawable);
|
|
|
|
|
|
|
|
/* Image has illegal bounds - ask the user what it wants to do */
|
|
|
|
|
|
|
|
if (badbounds_dialog())
|
|
|
|
{
|
|
|
|
gimp_run_procedure("gimp_crop", &nreturn_vals,
|
|
|
|
PARAM_IMAGE, image_ID,
|
|
|
|
PARAM_INT32, gimp_image_width(image_ID),
|
|
|
|
PARAM_INT32, gimp_image_height(image_ID),
|
|
|
|
PARAM_INT32, 0,
|
|
|
|
PARAM_INT32, 0,
|
|
|
|
PARAM_END);
|
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
else
|
|
|
|
gimp_drawable_detach(drawable);
|
|
|
|
}
|
|
|
|
|
|
|
|
g_free (layers);
|
|
|
|
|
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gint
|
|
|
|
save_image (char *filename,
|
|
|
|
gint32 image_ID,
|
|
|
|
gint32 drawable_ID)
|
|
|
|
{
|
|
|
|
GPixelRgn pixel_rgn;
|
|
|
|
GDrawable *drawable;
|
|
|
|
GDrawableType drawable_type;
|
|
|
|
FILE *outfile;
|
|
|
|
int Red[MAXCOLORS];
|
|
|
|
int Green[MAXCOLORS];
|
|
|
|
int Blue[MAXCOLORS];
|
|
|
|
guchar *cmap;
|
|
|
|
guint rows, cols;
|
1998-09-28 17:14:29 +00:00
|
|
|
int BitsPerPixel, liberalBPP=0, useBPP=0;
|
1997-11-24 22:05:25 +00:00
|
|
|
int colors;
|
|
|
|
char *temp_buf;
|
|
|
|
int i;
|
|
|
|
int transparent;
|
|
|
|
gint offset_x, offset_y;
|
|
|
|
|
|
|
|
gint32 *layers;
|
|
|
|
int nlayers;
|
|
|
|
|
|
|
|
gboolean is_gif89 = FALSE;
|
|
|
|
|
|
|
|
int Delay89;
|
|
|
|
int Disposal;
|
|
|
|
char *layer_name;
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
unsigned char bgred, bggreen, bgblue;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/* get a list of layers for this image_ID */
|
|
|
|
layers = gimp_image_get_layers (image_ID, &nlayers);
|
|
|
|
|
|
|
|
|
|
|
|
drawable_type = gimp_drawable_type (layers[0]);
|
|
|
|
|
|
|
|
|
|
|
|
/* If the image has multiple layers (i.e. will be animated), a comment,
|
|
|
|
or transparency, then it must be encoded as a GIF89a file, not a vanilla
|
|
|
|
GIF87a. */
|
|
|
|
if (nlayers>1)
|
|
|
|
is_gif89 = TRUE;
|
|
|
|
if (globalusecomment)
|
|
|
|
is_gif89 = TRUE;
|
|
|
|
|
|
|
|
switch (drawable_type)
|
|
|
|
{
|
|
|
|
case INDEXEDA_IMAGE:
|
|
|
|
is_gif89 = TRUE;
|
|
|
|
case INDEXED_IMAGE:
|
|
|
|
cmap = gimp_image_get_cmap (image_ID, &colors);
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
gimp_palette_get_background(&bgred, &bggreen, &bgblue);
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
for (i = 0; i < colors; i++)
|
|
|
|
{
|
|
|
|
Red[i] = *cmap++;
|
|
|
|
Green[i] = *cmap++;
|
|
|
|
Blue[i] = *cmap++;
|
|
|
|
}
|
|
|
|
for ( ; i < 256; i++)
|
|
|
|
{
|
1998-03-16 10:05:41 +00:00
|
|
|
Red[i] = bgred;
|
|
|
|
Green[i] = bggreen;
|
|
|
|
Blue[i] = bgblue;
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
break;
|
|
|
|
case GRAYA_IMAGE:
|
|
|
|
is_gif89 = TRUE;
|
|
|
|
case GRAY_IMAGE:
|
1998-03-16 10:05:41 +00:00
|
|
|
colors = 256; /* FIXME: Not ideal. */
|
1997-11-24 22:05:25 +00:00
|
|
|
for ( i = 0; i < 256; i++)
|
|
|
|
{
|
|
|
|
Red[i] = Green[i] = Blue[i] = i;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
default:
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: Sorry, can't save RGB images as GIFs - convert to INDEXED\nor GRAY first.\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return FALSE;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* init the progress meter */
|
|
|
|
temp_buf = g_malloc (strlen (filename) + 11);
|
|
|
|
sprintf (temp_buf, "Saving %s:", filename);
|
|
|
|
gimp_progress_init (temp_buf);
|
|
|
|
g_free (temp_buf);
|
|
|
|
|
|
|
|
|
|
|
|
/* open the destination file for writing */
|
|
|
|
outfile = fopen (filename, "wb");
|
|
|
|
if (!outfile)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: can't open %s\n", filename);
|
1997-11-24 22:05:25 +00:00
|
|
|
return FALSE;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* write the GIFheader */
|
|
|
|
|
|
|
|
if (colors < 256)
|
1998-03-16 10:05:41 +00:00
|
|
|
{
|
1998-09-15 20:34:30 +00:00
|
|
|
/* we keep track of how many bits we promised to have in liberalBPP,
|
|
|
|
so that we don't accidentally come under this when doing
|
|
|
|
clever transparency stuff where we can re-use wasted indices. */
|
|
|
|
liberalBPP = BitsPerPixel =
|
|
|
|
colorstobpp (colors + ((drawable_type==INDEXEDA_IMAGE) ? 1 : 0));
|
1998-03-16 10:05:41 +00:00
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
else
|
1998-03-16 10:05:41 +00:00
|
|
|
{
|
1998-09-28 17:14:29 +00:00
|
|
|
liberalBPP = BitsPerPixel =
|
|
|
|
colorstobpp (256);
|
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
if (drawable_type==INDEXEDA_IMAGE)
|
|
|
|
{
|
|
|
|
g_print ("GIF: Too many colours?\n");
|
|
|
|
}
|
1998-03-16 10:05:41 +00:00
|
|
|
}
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
cols = gimp_image_width(image_ID);
|
|
|
|
rows = gimp_image_height(image_ID);
|
1998-10-09 18:01:35 +00:00
|
|
|
Interlace = gsvals.interlace;
|
|
|
|
GIFEncodeHeader (outfile, is_gif89, cols, rows, 0,
|
|
|
|
BitsPerPixel, Red, Green, Blue, GetPixel);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/* If the image has multiple layers it'll be made into an
|
|
|
|
animated GIF, so write out the infinite-looping extension */
|
|
|
|
if ((nlayers > 1) && (gsvals.loop))
|
1998-10-09 18:01:35 +00:00
|
|
|
GIFEncodeLoopExt (outfile, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/* Write comment extension - mustn't be written before the looping ext. */
|
|
|
|
if (globalusecomment)
|
|
|
|
{
|
|
|
|
GIFEncodeCommentExt (outfile, globalcomment);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*** Now for each layer in the image, save an image in a compound GIF ***/
|
|
|
|
/************************************************************************/
|
|
|
|
|
|
|
|
i = nlayers-1;
|
|
|
|
|
|
|
|
while (i >= 0)
|
|
|
|
{
|
|
|
|
drawable_type = gimp_drawable_type (layers[i]);
|
|
|
|
drawable = gimp_drawable_get (layers[i]);
|
|
|
|
gimp_drawable_offsets (layers[i], &offset_x, &offset_y);
|
|
|
|
cols = drawable->width;
|
|
|
|
rows = drawable->height;
|
|
|
|
rowstride = drawable->width;
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
gimp_pixel_rgn_init (&pixel_rgn, drawable, 0, 0,
|
|
|
|
drawable->width, drawable->height, FALSE, FALSE);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
cur_progress = 0;
|
|
|
|
max_progress = drawable->height;
|
|
|
|
|
|
|
|
pixels = (guchar *) g_malloc (drawable->width *
|
|
|
|
drawable->height *
|
|
|
|
(((drawable_type == INDEXEDA_IMAGE)||
|
|
|
|
(drawable_type == GRAYA_IMAGE)) ? 2:1) );
|
|
|
|
|
1998-03-16 10:05:41 +00:00
|
|
|
gimp_pixel_rgn_get_rect (&pixel_rgn, pixels, 0, 0,
|
|
|
|
drawable->width, drawable->height);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
|
|
|
|
/* sort out whether we need to do transparency jiggery-pokery */
|
|
|
|
if ((drawable_type == INDEXEDA_IMAGE)||(drawable_type == GRAYA_IMAGE))
|
|
|
|
{
|
1997-12-08 00:22:45 +00:00
|
|
|
/* Try to find an entry which isn't actually used in the
|
|
|
|
image, for a transparency index. */
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1997-12-08 00:22:45 +00:00
|
|
|
transparent =
|
|
|
|
find_unused_ia_colour(pixels,
|
1998-09-15 20:34:30 +00:00
|
|
|
drawable->width * drawable->height,
|
|
|
|
bpptocolors(colorstobpp(colors)),
|
|
|
|
&colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
special_flatten_indexed_alpha (pixels,
|
|
|
|
&transparent,
|
|
|
|
&colors,
|
|
|
|
drawable->width * drawable->height);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
transparent = -1;
|
|
|
|
|
|
|
|
|
|
|
|
BitsPerPixel = colorstobpp (colors);
|
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
if (BitsPerPixel != liberalBPP)
|
|
|
|
{
|
|
|
|
/* We were able to re-use an index within the existing bitspace,
|
|
|
|
whereas the estimate in the header was pessimistic but still
|
|
|
|
needs to be upheld... */
|
1998-10-09 18:01:35 +00:00
|
|
|
#ifdef GIFDEBUG
|
|
|
|
g_warning("Promised %d bpp, pondered writing chunk with %d bpp!\n",
|
1998-09-15 20:34:30 +00:00
|
|
|
liberalBPP, BitsPerPixel);
|
1998-10-09 18:01:35 +00:00
|
|
|
#endif
|
|
|
|
g_warning("Transparent colour may be incorrect on viewers which"
|
|
|
|
" don't support transparency.\n");
|
1998-09-15 20:34:30 +00:00
|
|
|
}
|
|
|
|
useBPP = (BitsPerPixel > liberalBPP) ? BitsPerPixel : liberalBPP;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
if (is_gif89)
|
|
|
|
{
|
1997-12-12 10:01:21 +00:00
|
|
|
if (i>0)
|
|
|
|
{
|
|
|
|
layer_name = gimp_layer_get_name(layers[i-1]);
|
|
|
|
Disposal = parse_disposal_tag(layer_name);
|
|
|
|
g_free(layer_name);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
Disposal = gsvals.default_dispose;
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
layer_name = gimp_layer_get_name(layers[i]);
|
|
|
|
Delay89 = parse_ms_tag(layer_name);
|
|
|
|
g_free(layer_name);
|
|
|
|
|
|
|
|
if (Delay89 < 0)
|
|
|
|
Delay89 = gsvals.default_delay/10;
|
|
|
|
else
|
|
|
|
Delay89 /= 10;
|
|
|
|
|
|
|
|
GIFEncodeGraphicControlExt (outfile, Disposal, Delay89, nlayers,
|
1998-10-09 18:01:35 +00:00
|
|
|
cols, rows, 0,
|
1998-09-15 20:34:30 +00:00
|
|
|
transparent,
|
|
|
|
useBPP,
|
|
|
|
Red, Green,
|
1997-11-24 22:05:25 +00:00
|
|
|
Blue, GetPixel);
|
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
GIFEncodeImageData (outfile, cols, rows,
|
|
|
|
(rows>4) ? gsvals.interlace : 0,
|
|
|
|
0, transparent,
|
1998-09-15 20:34:30 +00:00
|
|
|
useBPP,
|
|
|
|
Red, Green, Blue, GetPixel,
|
1997-11-24 22:05:25 +00:00
|
|
|
offset_x, offset_y);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
gimp_drawable_detach (drawable);
|
|
|
|
|
|
|
|
g_free (pixels);
|
|
|
|
|
|
|
|
i--;
|
|
|
|
}
|
|
|
|
|
|
|
|
g_free(layers);
|
|
|
|
|
|
|
|
GIFEncodeClose (outfile, cols, rows, gsvals.interlace, 0, transparent,
|
1998-09-15 20:34:30 +00:00
|
|
|
useBPP, Red, Green, Blue, GetPixel);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
return TRUE;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gboolean
|
|
|
|
badbounds_dialog ( void )
|
|
|
|
{
|
|
|
|
GtkWidget *dlg;
|
|
|
|
GtkWidget *button;
|
|
|
|
GtkWidget *label;
|
|
|
|
GtkWidget *frame;
|
|
|
|
GtkWidget *vbox;
|
|
|
|
|
|
|
|
|
|
|
|
can_crop = FALSE;
|
|
|
|
|
|
|
|
|
|
|
|
dlg = gtk_dialog_new ();
|
|
|
|
gtk_window_set_title (GTK_WINDOW (dlg), "GIF Warning");
|
|
|
|
gtk_window_position (GTK_WINDOW (dlg), GTK_WIN_POS_MOUSE);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (dlg), "destroy",
|
|
|
|
(GtkSignalFunc) cropclose_callback,
|
|
|
|
dlg);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (dlg), "delete_event",
|
|
|
|
(GtkSignalFunc) cropclose_callback,
|
|
|
|
dlg);
|
|
|
|
|
|
|
|
/* Action area */
|
|
|
|
button = gtk_button_new_with_label ("Crop");
|
|
|
|
GTK_WIDGET_SET_FLAGS (button, GTK_CAN_DEFAULT);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) cropok_callback,
|
|
|
|
dlg);
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->action_area), button, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_grab_default (button);
|
|
|
|
gtk_widget_show (button);
|
|
|
|
|
|
|
|
button = gtk_button_new_with_label ("Cancel");
|
|
|
|
GTK_WIDGET_SET_FLAGS (button, GTK_CAN_DEFAULT);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) cropcancel_callback,
|
|
|
|
dlg);
|
|
|
|
/* gtk_signal_connect_object (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) gtk_widget_destroy,
|
|
|
|
GTK_OBJECT (dlg));
|
|
|
|
*/
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->action_area), button, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_show (button);
|
|
|
|
|
|
|
|
|
|
|
|
/* the warning message */
|
|
|
|
frame = gtk_frame_new (NULL);
|
|
|
|
gtk_frame_set_shadow_type (GTK_FRAME (frame), GTK_SHADOW_ETCHED_IN);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (frame), 10);
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->vbox), frame, TRUE, TRUE, 0);
|
|
|
|
vbox = gtk_vbox_new (FALSE, 5);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (vbox), 5);
|
|
|
|
gtk_container_add (GTK_CONTAINER (frame), vbox);
|
|
|
|
|
|
|
|
|
|
|
|
label= gtk_label_new(
|
|
|
|
"The image which you are trying to save as a GIF\n"
|
|
|
|
"contains layers which extend beyond the actual\n"
|
|
|
|
"borders of the image. This isn't allowed in GIFs,\n"
|
|
|
|
"I'm afraid.\n\n"
|
|
|
|
"You may choose whether to crop all of the layers to\n"
|
|
|
|
"the image borders, or cancel this save."
|
|
|
|
);
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), label, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_show(label);
|
|
|
|
|
|
|
|
gtk_widget_show(vbox);
|
|
|
|
|
|
|
|
gtk_widget_show(frame);
|
|
|
|
|
|
|
|
gtk_widget_show(dlg);
|
|
|
|
|
|
|
|
|
|
|
|
gtk_main ();
|
|
|
|
|
|
|
|
gtk_widget_destroy (GTK_WIDGET(dlg));
|
|
|
|
|
|
|
|
gdk_flush ();
|
|
|
|
|
|
|
|
return can_crop;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static gint
|
|
|
|
save_dialog ( gint32 image_ID )
|
|
|
|
{
|
|
|
|
GtkWidget *dlg;
|
|
|
|
GtkWidget *button;
|
|
|
|
GtkWidget *toggle;
|
|
|
|
GtkWidget *label;
|
|
|
|
GtkWidget *entry;
|
|
|
|
GtkWidget *frame;
|
|
|
|
GtkWidget *vbox;
|
|
|
|
GtkWidget *hbox;
|
1998-10-09 18:01:35 +00:00
|
|
|
GtkWidget *menu;
|
|
|
|
GtkWidget *disposal_option_menu;
|
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
GParasite* GIF2_CMNT;
|
|
|
|
#endif
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
gchar buffer[10];
|
|
|
|
gint32 nlayers;
|
|
|
|
|
|
|
|
|
|
|
|
gimp_image_get_layers (image_ID, &nlayers);
|
|
|
|
|
|
|
|
|
|
|
|
dlg = gtk_dialog_new ();
|
|
|
|
gtk_window_set_title (GTK_WINDOW (dlg), "Save as GIF");
|
|
|
|
gtk_window_position (GTK_WINDOW (dlg), GTK_WIN_POS_MOUSE);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (dlg), "destroy",
|
|
|
|
(GtkSignalFunc) save_close_callback,
|
|
|
|
NULL);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (dlg), "delete_event",
|
|
|
|
(GtkSignalFunc) save_windelete_callback,
|
|
|
|
dlg);
|
|
|
|
|
|
|
|
|
|
|
|
/* Action area */
|
|
|
|
button = gtk_button_new_with_label ("OK");
|
|
|
|
GTK_WIDGET_SET_FLAGS (button, GTK_CAN_DEFAULT);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) save_ok_callback,
|
|
|
|
dlg);
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->action_area), button, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_grab_default (button);
|
|
|
|
gtk_widget_show (button);
|
|
|
|
|
|
|
|
button = gtk_button_new_with_label ("Cancel");
|
|
|
|
GTK_WIDGET_SET_FLAGS (button, GTK_CAN_DEFAULT);
|
|
|
|
/* gtk_signal_connect_object (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) gtk_widget_destroy,
|
|
|
|
GTK_OBJECT (dlg)); */
|
|
|
|
gtk_signal_connect (GTK_OBJECT (button), "clicked",
|
|
|
|
(GtkSignalFunc) save_cancel_callback,
|
|
|
|
dlg);
|
|
|
|
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->action_area), button, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_show (button);
|
|
|
|
|
|
|
|
|
|
|
|
/* regular gif parameter settings */
|
|
|
|
frame = gtk_frame_new ("GIF Options");
|
|
|
|
gtk_frame_set_shadow_type (GTK_FRAME (frame), GTK_SHADOW_ETCHED_IN);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (frame), 10);
|
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->vbox), frame, TRUE, TRUE, 0);
|
|
|
|
vbox = gtk_vbox_new (FALSE, 5);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (vbox), 5);
|
|
|
|
gtk_container_add (GTK_CONTAINER (frame), vbox);
|
|
|
|
|
|
|
|
toggle = gtk_check_button_new_with_label ("Interlace");
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, TRUE, TRUE, 0);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (toggle), "toggled",
|
|
|
|
(GtkSignalFunc) save_toggle_update,
|
|
|
|
&gsvals.interlace);
|
|
|
|
gtk_toggle_button_set_state (GTK_TOGGLE_BUTTON (toggle), gsvals.interlace);
|
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
|
|
|
hbox = gtk_hbox_new(FALSE, 5);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (hbox), 0);
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, TRUE, TRUE, 0);
|
|
|
|
|
|
|
|
toggle = gtk_check_button_new_with_label ("GIF Comment: ");
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), toggle, FALSE, FALSE, 0);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (toggle), "toggled",
|
|
|
|
(GtkSignalFunc) save_toggle_update,
|
|
|
|
&globalusecomment);
|
|
|
|
gtk_toggle_button_set_state (GTK_TOGGLE_BUTTON (toggle), 1);
|
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
|
|
|
entry = gtk_entry_new ();
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), entry, TRUE, TRUE, 0);
|
|
|
|
gtk_widget_set_usize (entry, 240, 0);
|
1998-10-09 18:01:35 +00:00
|
|
|
if (globalcomment!=NULL)
|
|
|
|
{
|
|
|
|
g_free(globalcomment);
|
|
|
|
}
|
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
GIF2_CMNT = gimp_image_find_parasite (image_ID, "GIF2", "CMNT");
|
|
|
|
if (!gparasite_is_error(GIF2_CMNT))
|
|
|
|
{
|
|
|
|
globalcomment = g_malloc(GIF2_CMNT->size);
|
|
|
|
strcpy(globalcomment, GIF2_CMNT->data);
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
#endif
|
|
|
|
globalcomment = g_malloc(1+strlen(DEFAULT_COMMENT));
|
|
|
|
strcpy(globalcomment, DEFAULT_COMMENT);
|
|
|
|
#ifdef FACEHUGGERS
|
|
|
|
}
|
|
|
|
gparasite_free (GIF2_CMNT);
|
|
|
|
#endif
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_entry_set_text (GTK_ENTRY (entry), globalcomment);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (entry), "changed",
|
|
|
|
(GtkSignalFunc) comment_entry_callback,
|
|
|
|
NULL);
|
|
|
|
gtk_widget_show (entry);
|
|
|
|
|
|
|
|
gtk_widget_show (hbox);
|
|
|
|
|
|
|
|
gtk_widget_show (vbox);
|
|
|
|
gtk_widget_show (frame);
|
|
|
|
|
|
|
|
|
|
|
|
/* additional animated gif parameter settings */
|
|
|
|
frame = gtk_frame_new ("Animated GIF Options");
|
|
|
|
gtk_frame_set_shadow_type (GTK_FRAME (frame), GTK_SHADOW_ETCHED_IN);
|
1998-10-09 18:01:35 +00:00
|
|
|
gtk_container_border_width (GTK_CONTAINER (frame), 8);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (GTK_DIALOG (dlg)->vbox), frame, TRUE, TRUE, 0);
|
1998-10-09 18:01:35 +00:00
|
|
|
vbox = gtk_vbox_new (FALSE, 4);
|
|
|
|
gtk_container_border_width (GTK_CONTAINER (vbox), 4);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_container_add (GTK_CONTAINER (frame), vbox);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
toggle = gtk_check_button_new_with_label ("Loop forever");
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), toggle, TRUE, TRUE, 0);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (toggle), "toggled",
|
|
|
|
(GtkSignalFunc) save_toggle_update,
|
|
|
|
&gsvals.loop);
|
|
|
|
gtk_toggle_button_set_state (GTK_TOGGLE_BUTTON (toggle), gsvals.loop);
|
|
|
|
gtk_widget_show (toggle);
|
|
|
|
|
|
|
|
|
|
|
|
/* default_delay entry field */
|
1998-10-09 18:01:35 +00:00
|
|
|
hbox = gtk_hbox_new (FALSE, 4);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, TRUE, FALSE, 0);
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
label = gtk_label_new ("Delay between frames where unspecified: ");
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
|
|
|
|
|
|
|
entry = gtk_entry_new ();
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), entry, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_set_usize (entry, 80, 0);
|
|
|
|
sprintf (buffer, "%d", gsvals.default_delay);
|
|
|
|
gtk_entry_set_text (GTK_ENTRY (entry), buffer);
|
|
|
|
gtk_signal_connect (GTK_OBJECT (entry), "changed",
|
|
|
|
(GtkSignalFunc) save_entry_callback,
|
|
|
|
NULL);
|
|
|
|
gtk_widget_show (entry);
|
|
|
|
|
|
|
|
label = gtk_label_new (" milliseconds");
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
|
|
|
|
|
|
|
gtk_widget_show (hbox);
|
|
|
|
|
|
|
|
|
|
|
|
/* Disposal selector */
|
1998-10-09 18:01:35 +00:00
|
|
|
hbox = gtk_hbox_new (FALSE, 4);
|
|
|
|
gtk_box_pack_start (GTK_BOX (vbox), hbox, TRUE, FALSE, 0);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
label = gtk_label_new ("Frame disposal where unspecified: ");
|
|
|
|
gtk_box_pack_start (GTK_BOX (hbox), label, FALSE, FALSE, 0);
|
|
|
|
gtk_widget_show (label);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
disposal_option_menu = gtk_option_menu_new();
|
|
|
|
{
|
|
|
|
GtkWidget *menu_item;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
menu = gtk_menu_new();
|
|
|
|
{
|
|
|
|
menu_item = gtk_menu_item_new_with_label ("I don't care");
|
|
|
|
gtk_signal_connect( GTK_OBJECT(menu_item), "activate",
|
|
|
|
(GtkSignalFunc) disposal_select_callback,
|
|
|
|
&radio_pressed[0]);
|
|
|
|
gtk_container_add(GTK_CONTAINER(menu), menu_item);
|
|
|
|
gtk_widget_show(menu_item);
|
|
|
|
menu_item = gtk_menu_item_new_with_label ("Cumulative layers (combine)");
|
|
|
|
gtk_signal_connect( GTK_OBJECT(menu_item), "activate",
|
|
|
|
(GtkSignalFunc) disposal_select_callback,
|
|
|
|
&radio_pressed[1]);
|
|
|
|
gtk_container_add(GTK_CONTAINER(menu), menu_item);
|
|
|
|
gtk_widget_show(menu_item);
|
|
|
|
menu_item = gtk_menu_item_new_with_label ("One frame per layer (replace)");
|
|
|
|
gtk_signal_connect( GTK_OBJECT(menu_item), "activate",
|
|
|
|
(GtkSignalFunc) disposal_select_callback,
|
|
|
|
&radio_pressed[2]);
|
|
|
|
gtk_container_add(GTK_CONTAINER(menu), menu_item);
|
|
|
|
gtk_widget_show(menu_item);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
gtk_option_menu_set_menu (GTK_OPTION_MENU(disposal_option_menu), menu);
|
|
|
|
gtk_option_menu_set_history(GTK_OPTION_MENU(disposal_option_menu),
|
|
|
|
gsvals.default_dispose);
|
|
|
|
gtk_widget_show(disposal_option_menu);
|
|
|
|
gtk_box_pack_start(GTK_BOX(hbox), disposal_option_menu, TRUE, TRUE, 2);
|
1997-11-24 22:05:25 +00:00
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
gtk_widget_show (hbox);
|
1997-11-24 22:05:25 +00:00
|
|
|
gtk_widget_show (vbox);
|
|
|
|
|
|
|
|
/* If the image has only one layer it can't be animated, so
|
|
|
|
desensitize the animation options. */
|
|
|
|
|
|
|
|
if (nlayers == 1) gtk_widget_set_sensitive (frame, FALSE);
|
|
|
|
|
|
|
|
gtk_widget_show (frame);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
gtk_widget_show (dlg);
|
|
|
|
|
|
|
|
gtk_main ();
|
|
|
|
gdk_flush ();
|
|
|
|
|
|
|
|
return gsint.run;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static int
|
|
|
|
colorstobpp (int colors)
|
|
|
|
{
|
|
|
|
int bpp;
|
|
|
|
|
|
|
|
if (colors <= 2)
|
|
|
|
bpp = 1;
|
|
|
|
else if (colors <= 4)
|
|
|
|
bpp = 2;
|
|
|
|
else if (colors <= 8)
|
|
|
|
bpp = 3;
|
|
|
|
else if (colors <= 16)
|
|
|
|
bpp = 4;
|
|
|
|
else if (colors <= 32)
|
|
|
|
bpp = 5;
|
|
|
|
else if (colors <= 64)
|
|
|
|
bpp = 6;
|
|
|
|
else if (colors <= 128)
|
|
|
|
bpp = 7;
|
|
|
|
else if (colors <= 256)
|
|
|
|
bpp = 8;
|
|
|
|
else
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
g_warning ("GIF: colorstobpp - Eep! too many colours: %d\n", colors);
|
1997-11-24 22:05:25 +00:00
|
|
|
return 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
return bpp;
|
|
|
|
}
|
|
|
|
|
|
|
|
|
1998-09-15 20:34:30 +00:00
|
|
|
|
|
|
|
static int
|
|
|
|
bpptocolors (int bpp)
|
|
|
|
{
|
|
|
|
int colors;
|
|
|
|
|
|
|
|
if (bpp>8)
|
|
|
|
{
|
|
|
|
g_warning ("GIF: bpptocolors - Eep! bpp==%d !\n", bpp);
|
|
|
|
return 256;
|
|
|
|
}
|
|
|
|
|
|
|
|
colors = 1 << bpp;
|
|
|
|
|
|
|
|
return (colors);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
static int
|
|
|
|
GetPixel (int x,
|
|
|
|
int y)
|
|
|
|
{
|
|
|
|
return *(pixels + (rowstride * (long) y) + (long) x);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/*****************************************************************************
|
|
|
|
*
|
|
|
|
* GIFENCODE.C - GIF Image compression interface
|
|
|
|
*
|
|
|
|
* GIFEncode( FName, GHeight, GWidth, GInterlace, Background, Transparent,
|
|
|
|
* BitsPerPixel, Red, Green, Blue, GetPixel )
|
|
|
|
*
|
|
|
|
*****************************************************************************/
|
|
|
|
|
|
|
|
static int Width, Height;
|
|
|
|
static int curx, cury;
|
|
|
|
static long CountDown;
|
|
|
|
static int Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Bump the 'curx' and 'cury' to point to the next pixel
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
BumpPixel ()
|
|
|
|
{
|
|
|
|
/*
|
|
|
|
* Bump the current X position
|
|
|
|
*/
|
1998-10-09 18:01:35 +00:00
|
|
|
curx++;
|
1997-11-24 22:05:25 +00:00
|
|
|
|
|
|
|
/*
|
|
|
|
* If we are at the end of a scan line, set curx back to the beginning
|
|
|
|
* If we are interlaced, bump the cury to the appropriate spot,
|
|
|
|
* otherwise, just increment it.
|
|
|
|
*/
|
|
|
|
if (curx == Width)
|
|
|
|
{
|
|
|
|
cur_progress++;
|
|
|
|
if ((cur_progress % 16) == 0)
|
|
|
|
gimp_progress_update ((double) cur_progress / (double) max_progress);
|
|
|
|
|
|
|
|
curx = 0;
|
|
|
|
|
|
|
|
if (!Interlace)
|
|
|
|
++cury;
|
|
|
|
else
|
|
|
|
{
|
|
|
|
switch (Pass)
|
|
|
|
{
|
|
|
|
|
|
|
|
case 0:
|
|
|
|
cury += 8;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 4;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 1:
|
|
|
|
cury += 8;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 2;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 2:
|
|
|
|
cury += 4;
|
|
|
|
if (cury >= Height)
|
|
|
|
{
|
1998-10-09 18:01:35 +00:00
|
|
|
Pass++;
|
1997-11-24 22:05:25 +00:00
|
|
|
cury = 1;
|
|
|
|
}
|
|
|
|
break;
|
|
|
|
|
|
|
|
case 3:
|
|
|
|
cury += 2;
|
|
|
|
break;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Return the next pixel from the image
|
|
|
|
*/
|
|
|
|
static int
|
|
|
|
GIFNextPixel (ifunptr getpixel)
|
|
|
|
{
|
|
|
|
int r;
|
|
|
|
|
|
|
|
if (CountDown == 0)
|
|
|
|
return EOF;
|
|
|
|
|
|
|
|
--CountDown;
|
|
|
|
|
|
|
|
r = (*getpixel) (curx, cury);
|
|
|
|
|
|
|
|
BumpPixel ();
|
|
|
|
|
|
|
|
return r;
|
|
|
|
}
|
|
|
|
|
|
|
|
/* public */
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeHeader (FILE *fp,
|
|
|
|
gboolean gif89,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int Background,
|
|
|
|
int BitsPerPixel,
|
|
|
|
int Red[],
|
|
|
|
int Green[],
|
|
|
|
int Blue[],
|
|
|
|
ifunptr GetPixel)
|
|
|
|
{
|
|
|
|
int B;
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
int i;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Magic header
|
|
|
|
*/
|
|
|
|
fwrite (gif89 ? "GIF89a" : "GIF87a", 1, 6, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the screen width and height
|
|
|
|
*/
|
|
|
|
Putword (RWidth, fp);
|
|
|
|
Putword (RHeight, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate that there is a global colour map
|
|
|
|
*/
|
|
|
|
B = 0x80; /* Yes, there is a color map */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* OR in the resolution
|
|
|
|
*/
|
|
|
|
B |= (Resolution - 1) << 5;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* OR in the Bits per Pixel
|
|
|
|
*/
|
|
|
|
B |= (BitsPerPixel - 1);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write it out
|
|
|
|
*/
|
|
|
|
fputc (B, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the Background colour
|
|
|
|
*/
|
|
|
|
fputc (Background, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Byte of 0's (future expansion)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the Global Colour Map
|
|
|
|
*/
|
1998-10-09 18:01:35 +00:00
|
|
|
for (i = 0; i < ColorMapSize; i++)
|
1997-11-24 22:05:25 +00:00
|
|
|
{
|
|
|
|
fputc (Red[i], fp);
|
|
|
|
fputc (Green[i], fp);
|
|
|
|
fputc (Blue[i], fp);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeGraphicControlExt (FILE *fp,
|
|
|
|
int Disposal,
|
|
|
|
int Delay89,
|
|
|
|
int NumFramesInImage,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int Background,
|
|
|
|
int Transparent,
|
|
|
|
int BitsPerPixel,
|
|
|
|
int Red[],
|
|
|
|
int Green[],
|
|
|
|
int Blue[],
|
|
|
|
ifunptr GetPixel)
|
|
|
|
{
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out extension for transparent colour index, if necessary.
|
|
|
|
*/
|
|
|
|
if ( (Transparent >= 0) || (NumFramesInImage > 1) )
|
|
|
|
{
|
|
|
|
/* Extension Introducer - fixed. */
|
|
|
|
fputc ('!', fp);
|
|
|
|
/* Graphic Control Label - fixed. */
|
|
|
|
fputc (0xf9, fp);
|
|
|
|
/* Block Size - fixed. */
|
|
|
|
fputc (4, fp);
|
|
|
|
|
|
|
|
/* Packed Fields - XXXdddut (d=disposal, u=userInput, t=transFlag) */
|
|
|
|
/* s8421 */
|
|
|
|
fputc ( ((Transparent >= 0) ? 0x01 : 0x00) /* TRANSPARENCY */
|
|
|
|
|
|
|
|
/* DISPOSAL */
|
|
|
|
| ((NumFramesInImage > 1) ? (Disposal << 2) : 0x00 ),
|
|
|
|
/* 0x03 or 0x01 build frames cumulatively */
|
|
|
|
/* 0x02 clears frame before drawing */
|
|
|
|
/* 0x00 'don't care' */
|
|
|
|
|
|
|
|
fp);
|
|
|
|
|
|
|
|
fputc (Delay89 & 255, fp);
|
|
|
|
fputc ((Delay89>>8) & 255, fp);
|
|
|
|
|
|
|
|
fputc (Transparent, fp);
|
|
|
|
fputc (0, fp);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeImageData (FILE *fp,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int GInterlace,
|
|
|
|
int Background,
|
|
|
|
int Transparent,
|
|
|
|
int BitsPerPixel,
|
|
|
|
int Red[],
|
|
|
|
int Green[],
|
|
|
|
int Blue[],
|
|
|
|
ifunptr GetPixel,
|
|
|
|
gint offset_x,
|
|
|
|
gint offset_y)
|
|
|
|
{
|
|
|
|
int RWidth, RHeight;
|
|
|
|
int LeftOfs, TopOfs;
|
|
|
|
int Resolution;
|
|
|
|
int ColorMapSize;
|
|
|
|
int InitCodeSize;
|
|
|
|
|
|
|
|
Interlace = GInterlace;
|
|
|
|
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = (int) offset_x;
|
|
|
|
TopOfs = (int) offset_y;
|
|
|
|
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Calculate number of bits we are expecting
|
|
|
|
*/
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Indicate which pass we are on (if interlace)
|
|
|
|
*/
|
|
|
|
Pass = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
#if 0
|
|
|
|
/*
|
|
|
|
* Write an Image separator
|
|
|
|
*/
|
|
|
|
fputc (',', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Image header
|
|
|
|
*/
|
|
|
|
|
|
|
|
Putword (LeftOfs, fp);
|
|
|
|
Putword (TopOfs, fp);
|
|
|
|
Putword (Width, fp);
|
|
|
|
Putword (Height, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out whether or not the image is interlaced
|
|
|
|
*/
|
|
|
|
if (Interlace)
|
|
|
|
fputc (0x40, fp);
|
|
|
|
else
|
|
|
|
fputc (0x00, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the initial code size
|
|
|
|
*/
|
|
|
|
fputc (InitCodeSize, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Go and actually compress the data
|
|
|
|
*/
|
|
|
|
compress (InitCodeSize + 1, fp, GetPixel);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a Zero-length packet (to end the series)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
|
|
|
|
|
|
|
|
/***************************/
|
|
|
|
Interlace = GInterlace;
|
|
|
|
ColorMapSize = 1 << BitsPerPixel;
|
|
|
|
RWidth = Width = GWidth;
|
|
|
|
RHeight = Height = GHeight;
|
|
|
|
LeftOfs = TopOfs = 0;
|
|
|
|
Resolution = BitsPerPixel;
|
|
|
|
|
|
|
|
CountDown = (long) Width *(long) Height;
|
|
|
|
Pass = 0;
|
|
|
|
/*
|
|
|
|
* The initial code size
|
|
|
|
*/
|
|
|
|
if (BitsPerPixel <= 1)
|
|
|
|
InitCodeSize = 2;
|
|
|
|
else
|
|
|
|
InitCodeSize = BitsPerPixel;
|
|
|
|
/*
|
|
|
|
* Set up the current x and y position
|
|
|
|
*/
|
|
|
|
curx = cury = 0;
|
|
|
|
|
|
|
|
#endif
|
|
|
|
|
|
|
|
|
|
|
|
cur_progress = 0;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write an Image separator
|
|
|
|
*/
|
|
|
|
fputc (',', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write the Image header
|
|
|
|
*/
|
|
|
|
|
|
|
|
Putword (LeftOfs, fp);
|
|
|
|
Putword (TopOfs, fp);
|
|
|
|
Putword (Width, fp);
|
|
|
|
Putword (Height, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out whether or not the image is interlaced
|
|
|
|
*/
|
|
|
|
if (Interlace)
|
|
|
|
fputc (0x40, fp);
|
|
|
|
else
|
|
|
|
fputc (0x00, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out the initial code size
|
|
|
|
*/
|
|
|
|
fputc (InitCodeSize, fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Go and actually compress the data
|
|
|
|
*/
|
|
|
|
compress (InitCodeSize + 1, fp, GetPixel);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a Zero-length packet (to end the series)
|
|
|
|
*/
|
|
|
|
fputc (0, fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeClose (FILE *fp,
|
|
|
|
int GWidth,
|
|
|
|
int GHeight,
|
|
|
|
int GInterlace,
|
|
|
|
int Background,
|
|
|
|
int Transparent,
|
|
|
|
int BitsPerPixel,
|
|
|
|
int Red[],
|
|
|
|
int Green[],
|
|
|
|
int Blue[],
|
|
|
|
ifunptr GetPixel)
|
|
|
|
{
|
|
|
|
/*
|
|
|
|
* Write the GIF file terminator
|
|
|
|
*/
|
|
|
|
fputc (';', fp);
|
|
|
|
|
|
|
|
/*
|
|
|
|
* And close the file
|
|
|
|
*/
|
|
|
|
fclose (fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
GIFEncodeLoopExt (FILE *fp,
|
|
|
|
guint num_loops)
|
|
|
|
{
|
|
|
|
fputc(0x21,fp);
|
|
|
|
fputc(0xff,fp);
|
|
|
|
fputc(0x0b,fp);
|
|
|
|
fputs("NETSCAPE2.0",fp);
|
|
|
|
fputc(0x03,fp);
|
|
|
|
fputc(0x01,fp);
|
|
|
|
Putword(num_loops,fp);
|
|
|
|
fputc(0x00,fp);
|
|
|
|
|
|
|
|
/* NOTE: num_loops==0 means 'loop infinitely' */
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
static void GIFEncodeCommentExt (FILE *fp, char *comment)
|
|
|
|
{
|
|
|
|
if (comment==NULL||strlen(comment)<1)
|
|
|
|
{
|
1998-06-19 23:45:54 +00:00
|
|
|
g_print ("GIF: warning: no comment given - comment block not written.\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
fputc(0x21,fp);
|
|
|
|
fputc(0xfe,fp);
|
|
|
|
fputc(strlen(comment),fp);
|
|
|
|
fputs((const char *)comment,fp);
|
|
|
|
fputc(0x00,fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Write out a word to the GIF file
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
Putword (int w,
|
|
|
|
FILE *fp)
|
|
|
|
{
|
|
|
|
fputc (w & 0xff, fp);
|
|
|
|
fputc ((w / 256) & 0xff, fp);
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/***************************************************************************
|
|
|
|
*
|
|
|
|
* GIFCOMPR.C - GIF Image compression routines
|
|
|
|
*
|
|
|
|
* Lempel-Ziv compression based on 'compress'. GIF modifications by
|
|
|
|
* David Rowley (mgardi@watdcsu.waterloo.edu)
|
|
|
|
*
|
|
|
|
***************************************************************************/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* General DEFINEs
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define GIF_BITS 12
|
|
|
|
|
|
|
|
#define HSIZE 5003 /* 80% occupancy */
|
|
|
|
|
|
|
|
#ifdef NO_UCHAR
|
|
|
|
typedef char char_type;
|
|
|
|
#else /*NO_UCHAR */
|
|
|
|
typedef unsigned char char_type;
|
|
|
|
#endif /*NO_UCHAR */
|
|
|
|
|
|
|
|
/*
|
|
|
|
|
|
|
|
* GIF Image compression - modified 'compress'
|
|
|
|
*
|
|
|
|
* Based on: compress.c - File compression ala IEEE Computer, June 1984.
|
|
|
|
*
|
|
|
|
* By Authors: Spencer W. Thomas (decvax!harpo!utah-cs!utah-gr!thomas)
|
|
|
|
* Jim McKie (decvax!mcvax!jim)
|
|
|
|
* Steve Davies (decvax!vax135!petsd!peora!srd)
|
|
|
|
* Ken Turkowski (decvax!decwrl!turtlevax!ken)
|
|
|
|
* James A. Woods (decvax!ihnp4!ames!jaw)
|
|
|
|
* Joe Orost (decvax!vax135!petsd!joe)
|
|
|
|
*
|
|
|
|
*/
|
|
|
|
#include <ctype.h>
|
|
|
|
|
|
|
|
#define ARGVAL() (*++(*argv) || (--argc && *++argv))
|
|
|
|
|
|
|
|
static int n_bits; /* number of bits/code */
|
|
|
|
static int maxbits = GIF_BITS; /* user settable max # bits/code */
|
|
|
|
static code_int maxcode; /* maximum code, given n_bits */
|
|
|
|
static code_int maxmaxcode = (code_int) 1 << GIF_BITS; /* should NEVER generate this code */
|
|
|
|
#ifdef COMPATIBLE /* But wrong! */
|
|
|
|
#define MAXCODE(Mn_bits) ((code_int) 1 << (Mn_bits) - 1)
|
|
|
|
#else /*COMPATIBLE */
|
|
|
|
#define MAXCODE(Mn_bits) (((code_int) 1 << (Mn_bits)) - 1)
|
|
|
|
#endif /*COMPATIBLE */
|
|
|
|
|
|
|
|
static count_int htab[HSIZE];
|
|
|
|
static unsigned short codetab[HSIZE];
|
|
|
|
#define HashTabOf(i) htab[i]
|
|
|
|
#define CodeTabOf(i) codetab[i]
|
|
|
|
|
|
|
|
const code_int hsize = HSIZE; /* the original reason for this being
|
|
|
|
variable was "for dynamic table sizing",
|
|
|
|
but since it was never actually changed
|
|
|
|
I made it const --Adam. */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* To save much memory, we overlay the table used by compress() with those
|
|
|
|
* used by decompress(). The tab_prefix table is the same size and type
|
|
|
|
* as the codetab. The tab_suffix table needs 2**GIF_BITS characters. We
|
|
|
|
* get this from the beginning of htab. The output stack uses the rest
|
|
|
|
* of htab, and contains characters. There is plenty of room for any
|
|
|
|
* possible stack (stack used to be 8000 characters).
|
|
|
|
*/
|
|
|
|
|
|
|
|
#define tab_prefixof(i) CodeTabOf(i)
|
|
|
|
#define tab_suffixof(i) ((char_type*)(htab))[i]
|
|
|
|
#define de_stack ((char_type*)&tab_suffixof((code_int)1<<GIF_BITS))
|
|
|
|
|
|
|
|
static code_int free_ent = 0; /* first unused entry */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* block compression parameters -- after all codes are used up,
|
|
|
|
* and compression rate changes, start over.
|
|
|
|
*/
|
|
|
|
static int clear_flg = 0;
|
|
|
|
|
|
|
|
static int offset;
|
|
|
|
static long int in_count = 1; /* length of input */
|
|
|
|
static long int out_count = 0; /* # of codes output (for debugging) */
|
|
|
|
|
|
|
|
/*
|
|
|
|
* compress stdin to stdout
|
|
|
|
*
|
|
|
|
* Algorithm: use open addressing double hashing (no chaining) on the
|
|
|
|
* prefix code / next character combination. We do a variant of Knuth's
|
|
|
|
* algorithm D (vol. 3, sec. 6.4) along with G. Knott's relatively-prime
|
|
|
|
* secondary probe. Here, the modular division first probe is gives way
|
|
|
|
* to a faster exclusive-or manipulation. Also do block compression with
|
|
|
|
* an adaptive reset, whereby the code table is cleared when the compression
|
|
|
|
* ratio decreases, but after the table fills. The variable-length output
|
|
|
|
* codes are re-sized at this point, and a special CLEAR code is generated
|
|
|
|
* for the decompressor. Late addition: construct the table according to
|
|
|
|
* file size for noticeable speed improvement on small files. Please direct
|
|
|
|
* questions about this implementation to ames!jaw.
|
|
|
|
*/
|
|
|
|
|
|
|
|
static int g_init_bits;
|
|
|
|
static FILE *g_outfile;
|
|
|
|
|
|
|
|
static int ClearCode;
|
|
|
|
static int EOFCode;
|
|
|
|
|
|
|
|
|
|
|
|
static unsigned long cur_accum;
|
|
|
|
static int cur_bits;
|
|
|
|
|
|
|
|
static unsigned long masks[] =
|
|
|
|
{0x0000, 0x0001, 0x0003, 0x0007, 0x000F,
|
|
|
|
0x001F, 0x003F, 0x007F, 0x00FF,
|
|
|
|
0x01FF, 0x03FF, 0x07FF, 0x0FFF,
|
|
|
|
0x1FFF, 0x3FFF, 0x7FFF, 0xFFFF};
|
|
|
|
|
|
|
|
|
|
|
|
static void
|
|
|
|
compress (int init_bits,
|
|
|
|
FILE *outfile,
|
|
|
|
ifunptr ReadValue)
|
|
|
|
{
|
|
|
|
register long fcode;
|
|
|
|
register code_int i /* = 0 */ ;
|
|
|
|
register int c;
|
|
|
|
register code_int ent;
|
|
|
|
register code_int disp;
|
|
|
|
register code_int hsize_reg;
|
|
|
|
register int hshift;
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the globals: g_init_bits - initial number of bits
|
|
|
|
* g_outfile - pointer to output file
|
|
|
|
*/
|
|
|
|
g_init_bits = init_bits;
|
|
|
|
g_outfile = outfile;
|
|
|
|
|
|
|
|
cur_bits = 0;
|
|
|
|
cur_accum = 0;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the necessary values
|
|
|
|
*/
|
|
|
|
offset = 0;
|
|
|
|
out_count = 0;
|
|
|
|
clear_flg = 0;
|
|
|
|
in_count = 1;
|
|
|
|
|
|
|
|
ClearCode = (1 << (init_bits - 1));
|
|
|
|
EOFCode = ClearCode + 1;
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
|
|
|
|
|
|
|
|
/* Had some problems here... should be okay now. --Adam */
|
|
|
|
n_bits = g_init_bits;
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
char_init ();
|
|
|
|
|
|
|
|
ent = GIFNextPixel (ReadValue);
|
|
|
|
|
|
|
|
hshift = 0;
|
|
|
|
for (fcode = (long) hsize; fcode < 65536L; fcode *= 2L)
|
|
|
|
++hshift;
|
|
|
|
hshift = 8 - hshift; /* set hash code range bound */
|
|
|
|
|
|
|
|
hsize_reg = hsize;
|
|
|
|
cl_hash ((count_int) hsize_reg); /* clear hash table */
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
|
|
|
|
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != (unsigned) EOF)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
while ((c = GIFNextPixel (ReadValue)) != EOF)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
|
|
|
|
++in_count;
|
|
|
|
|
|
|
|
fcode = (long) (((long) c << maxbits) + ent);
|
|
|
|
i = (((code_int) c << hshift) ^ ent); /* xor hashing */
|
|
|
|
|
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
else if ((long) HashTabOf (i) < 0) /* empty slot */
|
|
|
|
goto nomatch;
|
|
|
|
disp = hsize_reg - i; /* secondary hash (after G. Knott) */
|
|
|
|
if (i == 0)
|
|
|
|
disp = 1;
|
|
|
|
probe:
|
|
|
|
if ((i -= disp) < 0)
|
|
|
|
i += hsize_reg;
|
|
|
|
|
|
|
|
if (HashTabOf (i) == fcode)
|
|
|
|
{
|
|
|
|
ent = CodeTabOf (i);
|
|
|
|
continue;
|
|
|
|
}
|
|
|
|
if ((long) HashTabOf (i) > 0)
|
|
|
|
goto probe;
|
|
|
|
nomatch:
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
ent = c;
|
|
|
|
#ifdef SIGNED_COMPARE_SLOW
|
|
|
|
if ((unsigned) free_ent < (unsigned) maxmaxcode)
|
|
|
|
{
|
|
|
|
#else /*SIGNED_COMPARE_SLOW */
|
|
|
|
if (free_ent < maxmaxcode)
|
|
|
|
{ /* } */
|
|
|
|
#endif /*SIGNED_COMPARE_SLOW */
|
|
|
|
CodeTabOf (i) = free_ent++; /* code -> hashtable */
|
|
|
|
HashTabOf (i) = fcode;
|
|
|
|
}
|
|
|
|
else
|
|
|
|
cl_block ();
|
|
|
|
}
|
|
|
|
/*
|
|
|
|
* Put out the final code.
|
|
|
|
*/
|
|
|
|
output ((code_int) ent);
|
|
|
|
++out_count;
|
|
|
|
output ((code_int) EOFCode);
|
|
|
|
}
|
|
|
|
|
|
|
|
/*****************************************************************
|
|
|
|
* TAG( output )
|
|
|
|
*
|
|
|
|
* Output the given code.
|
|
|
|
* Inputs:
|
|
|
|
* code: A n_bits-bit integer. If == -1, then EOF. This assumes
|
|
|
|
* that n_bits =< (long)wordsize - 1.
|
|
|
|
* Outputs:
|
|
|
|
* Outputs code to the file.
|
|
|
|
* Assumptions:
|
|
|
|
* Chars are 8 bits long.
|
|
|
|
* Algorithm:
|
|
|
|
* Maintain a GIF_BITS character long buffer (so that 8 codes will
|
|
|
|
* fit in it exactly). Use the VAX insv instruction to insert each
|
|
|
|
* code in turn. When the buffer fills up empty it and start over.
|
|
|
|
*/
|
|
|
|
|
|
|
|
static void
|
|
|
|
output (code_int code)
|
|
|
|
{
|
|
|
|
cur_accum &= masks[cur_bits];
|
|
|
|
|
|
|
|
if (cur_bits > 0)
|
|
|
|
cur_accum |= ((long) code << cur_bits);
|
|
|
|
else
|
|
|
|
cur_accum = code;
|
|
|
|
|
|
|
|
cur_bits += n_bits;
|
|
|
|
|
|
|
|
while (cur_bits >= 8)
|
|
|
|
{
|
|
|
|
char_out ((unsigned int) (cur_accum & 0xff));
|
|
|
|
cur_accum >>= 8;
|
|
|
|
cur_bits -= 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* If the next entry is going to be too big for the code size,
|
|
|
|
* then increase it, if possible.
|
|
|
|
*/
|
|
|
|
if (free_ent > maxcode || clear_flg)
|
|
|
|
{
|
|
|
|
|
|
|
|
if (clear_flg)
|
|
|
|
{
|
|
|
|
|
|
|
|
maxcode = MAXCODE (n_bits = g_init_bits);
|
|
|
|
clear_flg = 0;
|
|
|
|
|
|
|
|
}
|
|
|
|
else
|
|
|
|
{
|
|
|
|
|
|
|
|
++n_bits;
|
|
|
|
if (n_bits == maxbits)
|
|
|
|
maxcode = maxmaxcode;
|
|
|
|
else
|
|
|
|
maxcode = MAXCODE (n_bits);
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
if (code == EOFCode)
|
|
|
|
{
|
|
|
|
/*
|
|
|
|
* At EOF, write the rest of the buffer.
|
|
|
|
*/
|
|
|
|
while (cur_bits > 0)
|
|
|
|
{
|
|
|
|
char_out ((unsigned int) (cur_accum & 0xff));
|
|
|
|
cur_accum >>= 8;
|
|
|
|
cur_bits -= 8;
|
|
|
|
}
|
|
|
|
|
|
|
|
flush_char ();
|
|
|
|
|
|
|
|
fflush (g_outfile);
|
|
|
|
|
|
|
|
if (ferror (g_outfile))
|
|
|
|
writeerr ();
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Clear out the hash table
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
cl_block () /* table clear for block compress */
|
|
|
|
{
|
|
|
|
|
|
|
|
cl_hash ((count_int) hsize);
|
|
|
|
free_ent = ClearCode + 2;
|
|
|
|
clear_flg = 1;
|
|
|
|
|
|
|
|
output ((code_int) ClearCode);
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
cl_hash (register count_int hsize) /* reset code table */
|
|
|
|
{
|
|
|
|
|
|
|
|
register count_int *htab_p = htab + hsize;
|
|
|
|
|
|
|
|
register long i;
|
|
|
|
register long m1 = -1;
|
|
|
|
|
|
|
|
i = hsize - 16;
|
|
|
|
do
|
|
|
|
{ /* might use Sys V memset(3) here */
|
|
|
|
*(htab_p - 16) = m1;
|
|
|
|
*(htab_p - 15) = m1;
|
|
|
|
*(htab_p - 14) = m1;
|
|
|
|
*(htab_p - 13) = m1;
|
|
|
|
*(htab_p - 12) = m1;
|
|
|
|
*(htab_p - 11) = m1;
|
|
|
|
*(htab_p - 10) = m1;
|
|
|
|
*(htab_p - 9) = m1;
|
|
|
|
*(htab_p - 8) = m1;
|
|
|
|
*(htab_p - 7) = m1;
|
|
|
|
*(htab_p - 6) = m1;
|
|
|
|
*(htab_p - 5) = m1;
|
|
|
|
*(htab_p - 4) = m1;
|
|
|
|
*(htab_p - 3) = m1;
|
|
|
|
*(htab_p - 2) = m1;
|
|
|
|
*(htab_p - 1) = m1;
|
|
|
|
htab_p -= 16;
|
|
|
|
}
|
|
|
|
while ((i -= 16) >= 0);
|
|
|
|
|
|
|
|
for (i += 16; i > 0; --i)
|
|
|
|
*--htab_p = m1;
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
writeerr ()
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF: error writing output file\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
/******************************************************************************
|
|
|
|
*
|
|
|
|
* GIF Specific routines
|
|
|
|
*
|
|
|
|
******************************************************************************/
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Number of characters so far in this 'packet'
|
|
|
|
*/
|
|
|
|
static int a_count;
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Set up the 'byte output' routine
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
char_init ()
|
|
|
|
{
|
|
|
|
a_count = 0;
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Define the storage for the packet accumulator
|
|
|
|
*/
|
|
|
|
static char accum[256];
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Add a character to the end of the current packet, and if it is 254
|
|
|
|
* characters, flush the packet to disk.
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
char_out (int c)
|
|
|
|
{
|
|
|
|
accum[a_count++] = c;
|
|
|
|
if (a_count >= 254)
|
|
|
|
flush_char ();
|
|
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
|
|
* Flush the packet to disk, and reset the accumulator
|
|
|
|
*/
|
|
|
|
static void
|
|
|
|
flush_char ()
|
|
|
|
{
|
|
|
|
if (a_count > 0)
|
|
|
|
{
|
|
|
|
fputc (a_count, g_outfile);
|
|
|
|
fwrite (accum, 1, a_count, g_outfile);
|
|
|
|
a_count = 0;
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* crop dialog functions */
|
|
|
|
|
|
|
|
static void
|
|
|
|
cropok_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
can_crop = TRUE;
|
|
|
|
gtk_main_quit ();
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
cropcancel_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
can_crop = FALSE;
|
|
|
|
gtk_main_quit ();
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
cropclose_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gtk_main_quit ();
|
|
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* Save interface functions */
|
|
|
|
|
|
|
|
static void
|
|
|
|
save_close_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gtk_main_quit ();
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
save_ok_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gsint.run = TRUE;
|
|
|
|
gtk_widget_destroy (GTK_WIDGET (data));
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
save_cancel_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gsint.run = FALSE;
|
|
|
|
gtk_widget_destroy (GTK_WIDGET (data));
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
save_windelete_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gsint.run = FALSE;
|
|
|
|
}
|
|
|
|
|
1998-10-09 18:01:35 +00:00
|
|
|
static void
|
|
|
|
disposal_select_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
int* valptr;
|
|
|
|
|
|
|
|
valptr = (int*) data;
|
|
|
|
|
|
|
|
radio_pressed[0] = radio_pressed[1] = radio_pressed[2] = 0;
|
|
|
|
*valptr = 1;
|
|
|
|
}
|
|
|
|
|
1997-11-24 22:05:25 +00:00
|
|
|
static void
|
|
|
|
save_toggle_update (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
int *toggle_val;
|
|
|
|
|
|
|
|
toggle_val = (int *) data;
|
|
|
|
|
|
|
|
if (GTK_TOGGLE_BUTTON (widget)->active)
|
|
|
|
*toggle_val = TRUE;
|
|
|
|
else
|
|
|
|
*toggle_val = FALSE;
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
save_entry_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gsvals.default_delay = atoi (gtk_entry_get_text (GTK_ENTRY (widget)));
|
|
|
|
|
|
|
|
if (gsvals.default_delay < 0)
|
|
|
|
gsvals.default_delay = 0;
|
|
|
|
|
|
|
|
if (gsvals.default_delay > 65000)
|
|
|
|
gsvals.default_delay = 65000;
|
|
|
|
}
|
|
|
|
|
|
|
|
static void
|
|
|
|
comment_entry_callback (GtkWidget *widget,
|
|
|
|
gpointer data)
|
|
|
|
{
|
|
|
|
gint ssize;
|
|
|
|
|
|
|
|
ssize = strlen(gtk_entry_get_text (GTK_ENTRY (widget)));
|
|
|
|
|
|
|
|
/* Temporary kludge for overlength strings - just return */
|
|
|
|
if (ssize>240)
|
|
|
|
{
|
1998-05-30 07:32:37 +00:00
|
|
|
g_message ("GIF save: Your comment string is too long.\n");
|
1997-11-24 22:05:25 +00:00
|
|
|
return;
|
|
|
|
}
|
|
|
|
|
|
|
|
if (globalcomment!=NULL) g_free(globalcomment);
|
|
|
|
globalcomment = g_malloc(ssize+1);
|
|
|
|
|
|
|
|
strcpy(globalcomment, gtk_entry_get_text (GTK_ENTRY (widget)));
|
|
|
|
|
1998-05-30 07:32:37 +00:00
|
|
|
/* g_print ("COMMENT: %s\n",globalcomment); */
|
1997-11-24 22:05:25 +00:00
|
|
|
}
|
|
|
|
|
|
|
|
/* The End */
|